Eryzerin E
| Internal ID | 7f03ed41-8fb1-4c5a-b69c-2333381b06bf |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
| IUPAC Name | (6aS,11aS)-9-methoxy-4,10-bis(3-methylbut-2-enyl)-6,11a-dihydro-[1]benzofuro[3,2-c]chromene-3,6a-diol |
| SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OCC3(C2OC4=C3C=CC(=C4CC=C(C)C)OC)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1OC[C@@]3([C@H]2OC4=C3C=CC(=C4CC=C(C)C)OC)O)O)C |
| InChI | InChI=1S/C26H30O5/c1-15(2)6-8-17-21(27)12-10-19-23(17)30-14-26(28)20-11-13-22(29-5)18(9-7-16(3)4)24(20)31-25(19)26/h6-7,10-13,25,27-28H,8-9,14H2,1-5H3/t25-,26+/m0/s1 |
| InChI Key | XOWMUIMFYAHWQD-IZZNHLLZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 5.40 |
| (6aS,11aS)-3,6a-dihydroxy-9-methoxy-4,10- di(gamma,gamma)-dimethylallyl)pterocarpan |
| 9-Methoxy-4,10-bis-(3-methyl-but-2-enyl)-11aH-benzo[4,5]furo[3,2-c]chromene-3,6a-diol |
| (6aS,11aS)-9-methoxy-4,10-bis(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c]chromene-3,6a(11aH)-diol |
| 6H-benzofuro[3,2-c][1]benzopyran-3,6a(11aH)-diol, 9-methoxy-4,10-bis(3-methyl-2-butenyl)-, (6aS,11aS)- |
| InChI=1/C26H30O5/c1-15(2)6-8-17-21(27)12-10-19-23(17)30-14-26(28)20-11-13-22(29-5)18(9-7-16(3)4)24(20)31-25(19)26/h6-7,10-13,25,27-28H,8-9,14H2,1-5H3/t25-,26+/m0/s |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.66% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.74% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.63% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.97% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.55% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.36% | 97.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.34% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.30% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.24% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.94% | 92.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.66% | 100.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.76% | 85.30% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.53% | 94.03% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.89% | 93.40% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.71% | 96.90% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.45% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina zeyheri |
| PubChem | 641707 |
| LOTUS | LTS0195644 |
| wikiData | Q105337973 |