Erythrophlamine
Internal ID | 57aa0547-d5fc-4c58-9f1d-348f7c223800 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl (1R,2S,4aR,4bS,7E,8R,8aS,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-2-hydroxy-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
SMILES (Canonical) | CC1C2C(CCC1=CC(=O)OCCN(C)C)C3(CCC(C(C3CC2=O)(C)C(=O)OC)O)C |
SMILES (Isomeric) | C[C@@H]\1[C@H]2[C@H](CC/C1=C\C(=O)OCCN(C)C)[C@]3(CC[C@@H]([C@]([C@@H]3CC2=O)(C)C(=O)OC)O)C |
InChI | InChI=1S/C25H39NO6/c1-15-16(13-21(29)32-12-11-26(4)5)7-8-17-22(15)18(27)14-19-24(17,2)10-9-20(28)25(19,3)23(30)31-6/h13,15,17,19-20,22,28H,7-12,14H2,1-6H3/b16-13+/t15-,17-,19+,20-,22-,24+,25+/m0/s1 |
InChI Key | COOVABWZUIWIFI-ARWJVGBNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H39NO6 |
Molecular Weight | 449.60 g/mol |
Exact Mass | 449.27773796 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 2.70 |
(-)-Erythrophlamine |
Erythrophlamine [MI] |
UNII-521Q1FW81J |
521Q1FW81J |
511-00-2 |
(1R-(1alpha,2alpha,4aalpha,4bbeta,7E,8beta,8aalpha,10abeta))-7-(2-(2-(Dimethylamino)ethoxy)-2-oxoethylidene)tetradecahydro-2-hydroxy-1,4a,8-trimethyl-9-oxo-1-phenanthrenecarboxylic acid methyl ester |
Q27260945 |
(1R-(1.ALPHA.,2.ALPHA.,4A.ALPHA.,4B.BETA.,7E,8.BETA.,8A.ALPHA.,10A.BETA.))-7-(2-(2-(DIMETHYLAMINO)ETHOXY)-2-OXOETHYLIDENE)TETRADECAHYDRO-2-HYDROXY-1,4A,8-TRIMETHYL-9-OXO-1-PHENANTHRENECARBOXYLIC ACID METHYL ESTER |
![2D Structure of Erythrophlamine 2D Structure of Erythrophlamine](https://plantaedb.com/storage/docs/compounds/2023/11/erythrophlamine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.03% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.33% | 90.17% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.10% | 83.82% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.31% | 90.08% |
CHEMBL5028 | O14672 | ADAM10 | 89.14% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.34% | 95.93% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.93% | 97.33% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 86.86% | 86.67% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 86.70% | 96.76% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.70% | 91.19% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.23% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.78% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.24% | 86.33% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.24% | 98.75% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.18% | 96.90% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.39% | 95.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.99% | 100.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 80.81% | 98.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.44% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrophleum coumingo |
Erythrophleum suaveolens |
PubChem | 72941436 |
LOTUS | LTS0181097 |
wikiData | Q27260945 |