Erythro-1-(3-methoxy-4-hydroxy-phenyl)-propan-1,2-diol
| Internal ID | f06935ff-592d-49fc-955f-726649debdc5 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (1R,2S)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H14O4/c1-6(11)10(13)7-3-4-8(12)9(5-7)14-2/h3-6,10-13H,1-2H3/t6-,10-/m0/s1 |
| InChI Key | PZKYCBMLUGVAGH-WKEGUHRASA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | -0.20 |
| BDBM50337362 |
| erythro-1-(3-methoxy-4-hydroxy-phenyl)-propan-1,2-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.32% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.18% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.85% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.19% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.67% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.71% | 89.62% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.63% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.09% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.41% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.75% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.05% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.86% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.16% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber officinale |
| PubChem | 53320292 |
| NPASS | NPC181969 |
| ChEMBL | CHEMBL1682391 |
| LOTUS | LTS0166462 |
| wikiData | Q105217013 |