Erythristemine
Internal ID | 8a31639e-bbed-4464-8534-0670953720a6 |
Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
IUPAC Name | (2R,9R,13bS)-2,9,11,12-tetramethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline |
SMILES (Canonical) | COC1CC23C(=CCN2CC(C4=CC(=C(C=C34)OC)OC)OC)C=C1 |
SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)OC)C=C1 |
InChI | InChI=1S/C20H25NO4/c1-22-14-6-5-13-7-8-21-12-19(25-4)15-9-17(23-2)18(24-3)10-16(15)20(13,21)11-14/h5-7,9-10,14,19H,8,11-12H2,1-4H3/t14-,19-,20-/m0/s1 |
InChI Key | IUMRZRWBQPPMSS-GKCIPKSASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H25NO4 |
Molecular Weight | 343.40 g/mol |
Exact Mass | 343.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 1.60 |
28619-41-2 |
(2R,9R,13bS)-2,9,11,12-tetramethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinoline |
1H-Indolo[7a,1-a]isoquinoline, erythrinan deriv.; Erythristemin |
HY-N3858 |
AKOS032962321 |
FS-9716 |
CS-0024348 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.84% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.37% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.85% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.81% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.59% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.69% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.09% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.62% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 83.54% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.08% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 82.07% | 98.75% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.81% | 90.24% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.56% | 91.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.64% | 91.11% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.44% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina lysistemon |
Erythrina verna |
PubChem | 12143915 |
LOTUS | LTS0191131 |
wikiData | Q104398735 |