Erythrinan-16-ol, 1,2,6,7-tetradehydro-3,15-dimethoxy-, (3beta)-
Internal ID | c2955b25-6854-4734-9513-faf4b01d902e |
Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
IUPAC Name | 2,12-dimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-11-ol |
SMILES (Canonical) | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)O)C=C1 |
SMILES (Isomeric) | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)O)C=C1 |
InChI | InChI=1S/C18H21NO3/c1-21-14-4-3-13-6-8-19-7-5-12-9-16(20)17(22-2)10-15(12)18(13,19)11-14/h3-4,6,9-10,14,20H,5,7-8,11H2,1-2H3 |
InChI Key | BDIVMECULLJBMU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H21NO3 |
Molecular Weight | 299.40 g/mol |
Exact Mass | 299.15214353 g/mol |
Topological Polar Surface Area (TPSA) | 41.90 Ų |
XlogP | 1.80 |
BDIVMECULLJBMU-UHFFFAOYSA-N |
DTXSID401155791 |
3,15-Dimethoxy-1,2,6,7-tetradehydroerythrinan-16-ol, (3.beta.)- |
4,5,10,11-Tetrahydro-8,11-dimethoxy-2H-indolo[7a,1-a]isoquinolin-7-ol |
26215-56-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 |
50 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.99% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.38% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.22% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.20% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.02% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.58% | 90.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.37% | 91.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.35% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.47% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.65% | 94.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.80% | 95.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.29% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 85.25% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.74% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 83.13% | 98.75% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.08% | 93.40% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.87% | 91.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.40% | 91.07% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.16% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 622748 |
LOTUS | LTS0102989 |
wikiData | Q104924287 |