erythraddison III
Internal ID | 64394b17-4dd8-45d5-995f-58312819fcd3 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 3-prenylated isoflavanones |
IUPAC Name | (3S)-5,7-dihydroxy-3-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1)C2COC3=CC(=CC(=C3C2=O)O)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1)[C@H]2COC3=CC(=CC(=C3C2=O)O)O)OC)C |
InChI | InChI=1S/C21H22O5/c1-12(2)4-5-14-8-13(6-7-18(14)25-3)16-11-26-19-10-15(22)9-17(23)20(19)21(16)24/h4,6-10,16,22-23H,5,11H2,1-3H3/t16-/m1/s1 |
InChI Key | MGSNGDMLFQANLV-MRXNPFEDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H22O5 |
Molecular Weight | 354.40 g/mol |
Exact Mass | 354.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 4.80 |
erythraddison III |
BDBM50394207 |
![2D Structure of erythraddison III 2D Structure of erythraddison III](https://plantaedb.com/storage/docs/compounds/2023/11/erythraddison-iii.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.55% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.14% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.58% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.82% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.58% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.17% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.67% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.74% | 83.82% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.43% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.13% | 96.12% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.99% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.78% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.59% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.98% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.81% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.73% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.55% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 84.87% | 98.75% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.75% | 97.28% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.21% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 83.62% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.56% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.48% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina addisoniae |
PubChem | 71454955 |
LOTUS | LTS0035745 |
wikiData | Q105163547 |