Erythraddison A
| Internal ID | 7334c131-2fee-4287-a333-5b0a19635334 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
| IUPAC Name | 5-hydroxy-10-(hydroxymethyl)-7-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| SMILES (Canonical) | CC1(C=CC2=C(C3=C(C(=C2O1)CO)OC=C(C3=O)C4=CC=C(C=C4)O)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(C3=C(C(=C2O1)CO)OC=C(C3=O)C4=CC=C(C=C4)O)O)C |
| InChI | InChI=1S/C21H18O6/c1-21(2)8-7-13-17(24)16-18(25)15(11-3-5-12(23)6-4-11)10-26-20(16)14(9-22)19(13)27-21/h3-8,10,22-24H,9H2,1-2H3 |
| InChI Key | YJZULEGLRQGVFQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 3.10 |
| CHEMBL1271772 |
| BDBM50483014 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.18% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.90% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.29% | 93.10% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.00% | 98.35% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.50% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.19% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.99% | 91.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.73% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.70% | 94.45% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.45% | 86.92% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.35% | 97.28% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.94% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.84% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.83% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina addisoniae |
| PubChem | 50899658 |
| LOTUS | LTS0237042 |
| wikiData | Q105349570 |