Erymelanthine
| Internal ID | 8eebb367-c7a9-4c09-8637-66356009424f |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | methyl (2R,13bS)-2-methoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a][2,6]naphthyridine-12-carboxylate |
| SMILES (Canonical) | COC1CC23C(=CCN2CCC4=CN=C(C=C34)C(=O)OC)C=C1 |
| SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CN=C(C=C34)C(=O)OC)C=C1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-14-4-3-13-6-8-20-7-5-12-11-19-16(17(21)23-2)9-15(12)18(13,20)10-14/h3-4,6,9,11,14H,5,7-8,10H2,1-2H3/t14-,18-/m0/s1 |
| InChI Key | KCJQBANVNQOQJT-KSSFIOAISA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 51.70 Ų |
| XlogP | 1.30 |
| CHEMBL450858 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.49% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.96% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.53% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.86% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.07% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.96% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.70% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.40% | 94.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.09% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.40% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.39% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.84% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.80% | 90.71% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.81% | 91.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.57% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.41% | 85.14% |
| CHEMBL5028 | O14672 | ADAM10 | 81.68% | 97.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.23% | 94.33% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.75% | 97.21% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.30% | 96.25% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.29% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina melanacantha |
| Erythrina velutina |
| PubChem | 44570488 |
| LOTUS | LTS0267824 |
| wikiData | Q105138779 |