erybraedin B
Internal ID | 8e029bca-e9d6-4397-8ed6-4658ab072f8a |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 17,17-dimethyl-6-(3-methylbut-2-enyl)-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OCC3C2OC4=C3C=CC5=C4C=CC(O5)(C)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1OCC3C2OC4=C3C=CC5=C4C=CC(O5)(C)C)O)C |
InChI | InChI=1S/C25H26O4/c1-14(2)5-6-16-20(26)9-7-18-22(16)27-13-19-15-8-10-21-17(23(15)28-24(18)19)11-12-25(3,4)29-21/h5,7-12,19,24,26H,6,13H2,1-4H3 |
InChI Key | XDRMVDDOBVPELW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H26O4 |
Molecular Weight | 390.50 g/mol |
Exact Mass | 390.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 5.50 |
(6aR,11aR)-3-Hydroxy-4-prenyl-6'',6''-dimethylpyrano[2'',3'':9,10]pterocarpan |
LMPK12070027 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.22% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.64% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.62% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.32% | 90.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.63% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.35% | 94.73% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.59% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.26% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.98% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.93% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.83% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.51% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.35% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.24% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.56% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.43% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.55% | 91.49% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.68% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina abyssinica |
Erythrina mildbraedii |
Lespedeza floribunda |
PubChem | 44257439 |
LOTUS | LTS0249138 |
wikiData | Q104400319 |