Erybidine
| Internal ID | a8ca15fa-1531-4360-9378-904d8d1d4cf2 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 4,15,16-trimethoxy-10-methyl-10-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-5-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C=C2C3=CC(=C(C=C3CC1)OC)OC)OC)O |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C=C2C3=CC(=C(C=C3CC1)OC)OC)OC)O |
| InChI | InChI=1S/C20H25NO4/c1-21-7-5-13-9-17(22)18(23-2)11-15(13)16-12-20(25-4)19(24-3)10-14(16)6-8-21/h9-12,22H,5-8H2,1-4H3 |
| InChI Key | LWHZICJJSLUOJI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 2.40 |
| 34083-19-7 |
| 5H-Dibenz(d,f)azonin-3-ol, 6,7,8,9-tetrahydro-2,11,12-trimethoxy-7-methyl- |
| DTXSID80187681 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.21% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.72% | 92.94% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.54% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.56% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.43% | 90.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.22% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.73% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.12% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.08% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.64% | 93.40% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 87.38% | 95.70% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.28% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.02% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.85% | 95.89% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 86.70% | 95.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.34% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.93% | 85.14% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.75% | 95.62% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.54% | 93.65% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.00% | 91.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.05% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina mexicana |
| Erythrina variegata |
| PubChem | 169567 |
| LOTUS | LTS0233498 |
| wikiData | Q83059393 |