Ergocorninine
| Internal ID | 7c322ca2-1033-4eaa-a72e-cac6174a0616 |
| Taxonomy | Alkaloids and derivatives > Ergoline and derivatives > Lysergic acids and derivatives > Ergopeptines |
| IUPAC Name | (6aR,9S)-N-[(1S,2S,4R,7S)-2-hydroxy-5,8-dioxo-4,7-di(propan-2-yl)-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES (Canonical) | CC(C)C1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
| SMILES (Isomeric) | CC(C)[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C(C)C)NC(=O)[C@@H]4CN([C@@H]5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
| InChI | InChI=1S/C31H39N5O5/c1-16(2)26-28(38)35-11-7-10-24(35)31(40)36(26)29(39)30(41-31,17(3)4)33-27(37)19-12-21-20-8-6-9-22-25(20)18(14-32-22)13-23(21)34(5)15-19/h6,8-9,12,14,16-17,19,23-24,26,32,40H,7,10-11,13,15H2,1-5H3,(H,33,37)/t19-,23+,24-,26-,30+,31-/m0/s1 |
| InChI Key | UJYGDMFEEDNVBF-KMKPOGODSA-N |
| Popularity | 36 references in papers |
| Molecular Formula | C31H39N5O5 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.29511936 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | 2.40 |
| Atomic LogP (AlogP) | 2.04 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 4 |
| 564-37-4 |
| 6010ED1B7H |
| (6aR,9S)-N-[(1S,2S,4R,7S)-2-hydroxy-5,8-dioxo-4,7-di(propan-2-yl)-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| Isoergocornine |
| UNII-6010ED1B7H |
| EINECS 209-273-2 |
| 8-EPIERGOCORNINE |
| 8-ISOERGOCORNINE |
| SCHEMBL231138 |
| DTXSID10891860 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9551 | 95.51% |
| Caco-2 | - | 0.8174 | 81.74% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.9143 | 91.43% |
| Subcellular localzation | Nucleus | 0.3809 | 38.09% |
| OATP2B1 inhibitior | - | 0.5674 | 56.74% |
| OATP1B1 inhibitior | + | 0.8720 | 87.20% |
| OATP1B3 inhibitior | + | 0.9126 | 91.26% |
| MATE1 inhibitior | + | 0.9967 | 99.67% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | + | 0.8920 | 89.20% |
| P-glycoprotein inhibitior | - | 0.5804 | 58.04% |
| P-glycoprotein substrate | + | 0.6686 | 66.86% |
| CYP3A4 substrate | + | 0.7844 | 78.44% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7671 | 76.71% |
| CYP3A4 inhibition | + | 0.7960 | 79.60% |
| CYP2C9 inhibition | - | 0.9182 | 91.82% |
| CYP2C19 inhibition | + | 0.5493 | 54.93% |
| CYP2D6 inhibition | - | 0.9236 | 92.36% |
| CYP1A2 inhibition | + | 0.9107 | 91.07% |
| CYP2C8 inhibition | + | 0.5566 | 55.66% |
| CYP inhibitory promiscuity | - | 0.7734 | 77.34% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.5098 | 50.98% |
| Eye corrosion | - | 0.9874 | 98.74% |
| Eye irritation | - | 0.9588 | 95.88% |
| Skin irritation | - | 0.7391 | 73.91% |
| Skin corrosion | - | 0.9245 | 92.45% |
| Ames mutagenesis | - | 0.7800 | 78.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7335 | 73.35% |
| Micronuclear | + | 0.8500 | 85.00% |
| Hepatotoxicity | - | 0.7015 | 70.15% |
| skin sensitisation | - | 0.8620 | 86.20% |
| Respiratory toxicity | + | 0.9778 | 97.78% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 1.0000 | 100.00% |
| Nephrotoxicity | - | 0.7744 | 77.44% |
| Acute Oral Toxicity (c) | III | 0.5849 | 58.49% |
| Estrogen receptor binding | + | 0.8305 | 83.05% |
| Androgen receptor binding | + | 0.6506 | 65.06% |
| Thyroid receptor binding | + | 0.5391 | 53.91% |
| Glucocorticoid receptor binding | + | 0.7350 | 73.50% |
| Aromatase binding | + | 0.7947 | 79.47% |
| PPAR gamma | + | 0.8041 | 80.41% |
| Honey bee toxicity | - | 0.7577 | 75.77% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | - | 0.5550 | 55.50% |
| Fish aquatic toxicity | + | 0.9809 | 98.09% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
398.1 nM |
Potency |
via Super-PRED
|
| CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
10 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.78% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.18% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.54% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.34% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 96.26% | 93.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.09% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.54% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.16% | 97.25% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 94.13% | 95.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.08% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.03% | 89.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 90.24% | 92.97% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.14% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.67% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.20% | 94.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.18% | 83.10% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.29% | 96.77% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.98% | 90.08% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.90% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.88% | 93.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.81% | 97.64% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.07% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.82% | 88.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.65% | 99.18% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.93% | 98.05% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.83% | 90.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.95% | 91.19% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.90% | 91.24% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.87% | 97.56% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.45% | 85.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.15% | 96.47% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.13% | 97.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.91% | 98.75% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.06% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10007994 |
| LOTUS | LTS0055706 |
| wikiData | Q27263132 |