eq-4''-Hydroxymaysin
Internal ID | 488042d8-8987-42e0-930b-9b737056fe45 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides |
IUPAC Name | 6-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)C2=C(C3=C(C=C2O)OC(=CC3=O)C4=CC(=C(C=C4)O)O)O)OC5C(C(C(C(O5)C)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)C2=C(C3=C(C=C2O)OC(=CC3=O)C4=CC(=C(C=C4)O)O)O)OC5C(C(C(C(O5)C)O)O)O)O)O |
InChI | InChI=1S/C27H30O14/c1-8-20(33)23(36)26(41-27-24(37)22(35)19(32)9(2)39-27)25(38-8)18-14(31)7-16-17(21(18)34)13(30)6-15(40-16)10-3-4-11(28)12(29)5-10/h3-9,19-20,22-29,31-37H,1-2H3 |
InChI Key | QXHHBGFIPDPRAX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O14 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.70% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.54% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.30% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.94% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.82% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.03% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.41% | 95.56% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.23% | 83.57% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.47% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.73% | 85.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.58% | 97.36% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.71% | 90.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.04% | 83.00% |
CHEMBL3194 | P02766 | Transthyretin | 83.25% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.94% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eremochloa ophiuroides |
Zea mays |
PubChem | 131750983 |
LOTUS | LTS0157517 |
wikiData | Q105229609 |