Epoxyoleic acid
| Internal ID | ebf384c8-17b8-4c51-a375-1694397aaa3a |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Lineolic acids and derivatives |
| IUPAC Name | 8-[(2S,3R)-3-octyloxiran-2-yl]octanoic acid |
| SMILES (Canonical) | CCCCCCCCC1C(O1)CCCCCCCC(=O)O |
| SMILES (Isomeric) | CCCCCCCC[C@@H]1[C@@H](O1)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/t16-,17+/m1/s1 |
| InChI Key | IMYZYCNQZDBZBQ-SJORKVTESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.25079494 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 6.10 |
| 24560-98-3 |
| rac cis-9,10-Epoxystearic Acid |
| Octadecanoic acid, 9,10-epoxy-, cis- |
| 8-[(2S,3R)-3-octyloxiran-2-yl]octanoic acid |
| Oxiraneoctanoic acid, 3-octyl-, cis- |
| cis-9,10-Epoxyoctadecanoic acid |
| cis-?9,?10-?Epoxystearic acid |
| 9S,10R-epoxy-stearic acid |
| V168Q47TLP |
| 9,10-Epoxystearic acid, cis- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.25% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.44% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.07% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.27% | 92.08% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.93% | 92.50% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.11% | 83.82% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.53% | 89.63% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.92% | 97.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.82% | 96.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.35% | 94.73% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.35% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.90% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Shorea robusta |
| PubChem | 119250 |
| LOTUS | LTS0043607 |
| wikiData | Q83049812 |