Epiphyllic acid
Internal ID | d41d85f5-316c-4dbe-8488-ec99865cd09f |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
IUPAC Name | (1R,2S)-1-(3,4-dihydroxyphenyl)-6,7-dihydroxy-1,2-dihydronaphthalene-2,3-dicarboxylic acid |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(=CC3=CC(=C(C=C23)O)O)C(=O)O)C(=O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1[C@H]2[C@@H](C(=CC3=CC(=C(C=C23)O)O)C(=O)O)C(=O)O)O)O |
InChI | InChI=1S/C18H14O8/c19-11-2-1-7(4-12(11)20)15-9-6-14(22)13(21)5-8(9)3-10(17(23)24)16(15)18(25)26/h1-6,15-16,19-22H,(H,23,24)(H,25,26)/t15-,16-/m1/s1 |
InChI Key | WJMFXQBNYLYADA-HZPDHXFCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H14O8 |
Molecular Weight | 358.30 g/mol |
Exact Mass | 358.06886740 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 1.50 |
CHEMBL172933 |
DTXSID40904230 |
152367-34-5 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.27% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.75% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.34% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 88.13% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.95% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.93% | 94.45% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.60% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.31% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bazzania trilobata |
Chiloscyphus polyanthos |
Lepicolea ochroleuca |
Lepidozia incurvata |
Lophocolea heterophylla |
PubChem | 44383640 |
LOTUS | LTS0120911 |
wikiData | Q82873475 |