Epicatechin 5,3'-dimethyl ether
Internal ID | 39b7623e-fcea-4328-8767-def9f657a88d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins |
IUPAC Name | (2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-5-methoxy-3,4-dihydro-2H-chromene-3,7-diol |
SMILES (Canonical) | COC1=CC(=CC2=C1CC(C(O2)C3=CC(=C(C=C3)O)OC)O)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C[C@H]([C@H](O2)C3=CC(=C(C=C3)O)OC)O)O |
InChI | InChI=1S/C17H18O6/c1-21-14-6-10(18)7-15-11(14)8-13(20)17(23-15)9-3-4-12(19)16(5-9)22-2/h3-7,13,17-20H,8H2,1-2H3/t13-,17-/m1/s1 |
InChI Key | BVMRDMUAFYCABS-CXAGYDPISA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H18O6 |
Molecular Weight | 318.32 g/mol |
Exact Mass | 318.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 88.40 Ų |
XlogP | 1.00 |
SCHEMBL862110 |
LMPK12020139 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.19% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.06% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.30% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 89.50% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.44% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.35% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.18% | 99.15% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.05% | 88.48% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.80% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.79% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.83% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.91% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.81% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.59% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.26% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.25% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lindera umbellata |
PubChem | 21626709 |
LOTUS | LTS0133031 |
wikiData | Q76512026 |