Epiaschantin
Internal ID | e9e18b07-3044-44eb-91e7-57dc743b1797 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 5-[(3S,3aR,6R,6aR)-6-(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)C2C3COC(C3CO2)C4=CC5=C(C=C4)OCO5 |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC5=C(C=C4)OCO5 |
InChI | InChI=1S/C22H24O7/c1-23-18-7-13(8-19(24-2)22(18)25-3)21-15-10-26-20(14(15)9-27-21)12-4-5-16-17(6-12)29-11-28-16/h4-8,14-15,20-21H,9-11H2,1-3H3/t14-,15-,20+,21-/m0/s1 |
InChI Key | ONDWGDNAFRAXCN-YJPXFSGGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H24O7 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 2.80 |
41689-50-3 |
(+)-epiaschantin |
CHEMBL480876 |
HY-N7279 |
AKOS040761681 |
FS-8833 |
CS-0112941 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.22% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.87% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.74% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.76% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.39% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.26% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.15% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.93% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.64% | 96.77% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.08% | 97.14% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.49% | 94.80% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.46% | 82.67% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.44% | 88.48% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.29% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.87% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.96% | 94.00% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.65% | 85.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.28% | 89.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.38% | 94.03% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.06% | 80.96% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.95% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea holosericea |
Artemisia absinthium |
Artemisia siversiana |
Hernandia sonora |
PubChem | 10408679 |
LOTUS | LTS0115969 |
wikiData | Q105194615 |