ent-Epipeltogynan-4alpha-ol
Internal ID | 9560b563-e518-4081-9747-4fcdbf75a6bf |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6aS,7R,12aS)-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-2,3,7,10-tetrol |
SMILES (Canonical) | C1C2=CC(=C(C=C2C3C(O1)C(C4=C(O3)C=C(C=C4)O)O)O)O |
SMILES (Isomeric) | C1C2=CC(=C(C=C2[C@H]3[C@@H](O1)[C@@H](C4=C(O3)C=C(C=C4)O)O)O)O |
InChI | InChI=1S/C16H14O6/c17-8-1-2-9-13(4-8)22-15-10-5-12(19)11(18)3-7(10)6-21-16(15)14(9)20/h1-5,14-20H,6H2/t14-,15+,16+/m1/s1 |
InChI Key | OPWUVOPHCMWWGJ-PMPSAXMXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H14O6 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 0.80 |
LMPK12020222 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.03% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.43% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.82% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.40% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.88% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 84.48% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.48% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.88% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.26% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.60% | 98.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.52% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia peuce |
Peltogyne paniculata |
PubChem | 44257170 |
LOTUS | LTS0255073 |
wikiData | Q105196620 |