Enoxolone
Internal ID | ee2a07b8-6ed3-4060-9c59-b274468c8fb7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1O)C)C(=O)C=C4C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C |
SMILES (Isomeric) | C[C@]12CC[C@](C[C@H]1C3=CC(=O)[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)(C)C(=O)O |
InChI | InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1 |
InChI Key | MPDGHEJMBKOTSU-YKLVYJNSSA-N |
Popularity | 2,480 references in papers |
Molecular Formula | C30H46O4 |
Molecular Weight | 470.70 g/mol |
Exact Mass | 470.33960994 g/mol |
Topological Polar Surface Area (TPSA) | 74.60 Ų |
XlogP | 6.40 |
Atomic LogP (AlogP) | 6.41 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
471-53-4 |
Glycyrrhetic acid |
Uralenic acid |
GLYCYRRHETINIC ACID |
18-beta-Glycyrrhetinic acid |
Biosone |
Rhetinic Acid |
Glycyrrhetin |
Arthrodont |
18beta-Glycyrrhetinic acid |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9930 | 99.30% |
Caco-2 | - | 0.5154 | 51.54% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | + | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.8912 | 89.12% |
OATP2B1 inhibitior | - | 0.8587 | 85.87% |
OATP1B1 inhibitior | - | 0.7738 | 77.38% |
OATP1B3 inhibitior | - | 0.5698 | 56.98% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.5321 | 53.21% |
BSEP inhibitior | + | 0.9142 | 91.42% |
P-glycoprotein inhibitior | - | 0.6281 | 62.81% |
P-glycoprotein substrate | - | 0.9362 | 93.62% |
CYP3A4 substrate | + | 0.6689 | 66.89% |
CYP2C9 substrate | - | 0.7735 | 77.35% |
CYP2D6 substrate | - | 0.9031 | 90.31% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9317 | 93.17% |
CYP2C19 inhibition | - | 0.9604 | 96.04% |
CYP2D6 inhibition | - | 0.9538 | 95.38% |
CYP1A2 inhibition | - | 0.9296 | 92.96% |
CYP2C8 inhibition | - | 0.7149 | 71.49% |
CYP inhibitory promiscuity | - | 0.9544 | 95.44% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6941 | 69.41% |
Eye corrosion | - | 0.9945 | 99.45% |
Eye irritation | - | 0.9397 | 93.97% |
Skin irritation | + | 0.6462 | 64.62% |
Skin corrosion | - | 0.9582 | 95.82% |
Ames mutagenesis | - | 0.8144 | 81.44% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5310 | 53.10% |
Micronuclear | - | 0.7600 | 76.00% |
Hepatotoxicity | - | 0.5000 | 50.00% |
skin sensitisation | + | 0.5247 | 52.47% |
Respiratory toxicity | + | 0.6778 | 67.78% |
Reproductive toxicity | + | 0.9444 | 94.44% |
Mitochondrial toxicity | + | 0.8625 | 86.25% |
Nephrotoxicity | + | 0.4802 | 48.02% |
Acute Oral Toxicity (c) | III | 0.8402 | 84.02% |
Estrogen receptor binding | + | 0.6805 | 68.05% |
Androgen receptor binding | + | 0.6907 | 69.07% |
Thyroid receptor binding | + | 0.6218 | 62.18% |
Glucocorticoid receptor binding | + | 0.8971 | 89.71% |
Aromatase binding | + | 0.7351 | 73.51% |
PPAR gamma | + | 0.6412 | 64.12% |
Honey bee toxicity | - | 0.8488 | 84.88% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
Fish aquatic toxicity | + | 0.9975 | 99.75% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 |
13 nM 11.78 nM 8.6 nM 29.1 nM 29.1 nM 8.6 nM |
IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 18653260
PMID: 18242087 via Super-PRED PMID: 25590374 PMID: 23747808 PMID: 21873057 |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 |
257 nM 1.22 nM 1.2 nM 257 nM 1.2 nM |
IC50 IC50 IC50 IC50 IC50 |
PMID: 21376605
PMID: 23747808 PMID: 25590374 PMID: 20851614 via Super-PRED |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase |
20970 nM |
IC50 |
PMID: 26900660
|
CHEMBL5983 | O60218 | Aldo-keto reductase family 1 member B10 |
4900 nM |
IC50 |
PMID: 21561086
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
39810.7 nM 354.8 nM 39810.7 nM |
Potency Potency Potency |
via CMAUP
via Super-PRED via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
89.1 nM 89.1 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL3616 | P24723 | Protein kinase C eta |
250 nM |
Kd |
via Super-PRED
|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
45800 nM |
IC50 |
PMID: 21193311
|
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C |
9600 nM |
IC50 |
PMID: 21193311
|
CHEMBL1697668 | Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 |
524.81 nM |
IC50 |
PMID: 23571415
|
CHEMBL1743121 | Q9NPD5 | Solute carrier organic anion transporter family member 1B3 |
549.54 nM |
IC50 |
PMID: 23571415
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.12% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.72% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.41% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 89.42% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.88% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.80% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.44% | 82.69% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.26% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.77% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.00% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.69% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.11% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza |
Glycyrrhiza glabra |
Glycyrrhiza inflata |
Glycyrrhiza uralensis |
Glycyrrhiza uralensis |
Mitracarpus hirtus |
PubChem | 10114 |
NPASS | NPC233455 |
ChEMBL | CHEMBL230006 |
LOTUS | LTS0198644 |
wikiData | Q5948038 |