Emmotin A
Internal ID | daac359c-7ee7-4ed8-b9bb-928565883344 |
Taxonomy | Benzenoids > Tetralins |
IUPAC Name | (2R,3S)-2-hydroxy-3-(2-hydroxypropan-2-yl)-8-(methoxymethyl)-5-methyl-3,4-dihydro-2H-naphthalen-1-one |
SMILES (Canonical) | CC1=C2CC(C(C(=O)C2=C(C=C1)COC)O)C(C)(C)O |
SMILES (Isomeric) | CC1=C2C[C@@H]([C@H](C(=O)C2=C(C=C1)COC)O)C(C)(C)O |
InChI | InChI=1S/C16H22O4/c1-9-5-6-10(8-20-4)13-11(9)7-12(16(2,3)19)14(17)15(13)18/h5-6,12,14,17,19H,7-8H2,1-4H3/t12-,14+/m0/s1 |
InChI Key | GRTATZFIZSZURL-GXTWGEPZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H22O4 |
Molecular Weight | 278.34 g/mol |
Exact Mass | 278.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 1.90 |
CHEBI:166674 |
LMPR0103200001 |
(2R,3S)-2-hydroxy-3-(2-hydroxypropan-2-yl)-8-(methoxymethyl)-5-methyl-3,4-dihydro-2H-naphthalen-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.81% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.44% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.14% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.83% | 95.56% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.72% | 90.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.10% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.67% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.04% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.72% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.65% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.60% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.86% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Emmotum nitens |
PubChem | 42608142 |
LOTUS | LTS0136465 |
wikiData | Q76535254 |