Emerimidine B
Internal ID | 4368733a-31f1-432f-a5c6-859cdd5fb022 |
Taxonomy | Organoheterocyclic compounds > Isoindoles and derivatives > Isoindolines > Isoindolones |
IUPAC Name | 5-hydroxy-4,6-dimethoxy-2,3-dihydroisoindol-1-one |
SMILES (Canonical) | COC1=C(C(=C2CNC(=O)C2=C1)OC)O |
SMILES (Isomeric) | COC1=C(C(=C2CNC(=O)C2=C1)OC)O |
InChI | InChI=1S/C10H11NO4/c1-14-7-3-5-6(4-11-10(5)13)9(15-2)8(7)12/h3,12H,4H2,1-2H3,(H,11,13) |
InChI Key | HCTMLWLGLOOXBU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C10H11NO4 |
Molecular Weight | 209.20 g/mol |
Exact Mass | 209.06880783 g/mol |
Topological Polar Surface Area (TPSA) | 67.80 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.95% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 91.08% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 90.73% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.31% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.24% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.58% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.69% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.59% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.65% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.95% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.41% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.03% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aegiceras corniculatum |
PubChem | 53363662 |
LOTUS | LTS0068649 |
wikiData | Q104167708 |