Elmonin
| Internal ID | ff9cb47a-92b5-4946-b62a-89fba3a0db35 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthols and derivatives |
| IUPAC Name | (3R)-7-methoxy-10'-methylspiro[1H-2-benzofuran-3,3'-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-5'-ol |
| SMILES (Canonical) | CC1=CC2=C3C(=C1)OC4(C3=C(C=C2)O)C5=C(CO4)C(=CC=C5)OC |
| SMILES (Isomeric) | CC1=CC2=C3C(=C1)O[C@@]4(C3=C(C=C2)O)C5=C(CO4)C(=CC=C5)OC |
| InChI | InChI=1S/C20H16O4/c1-11-8-12-6-7-15(21)19-18(12)17(9-11)24-20(19)14-4-3-5-16(22-2)13(14)10-23-20/h3-9,21H,10H2,1-2H3/t20-/m1/s1 |
| InChI Key | XEOIJMSRWFEZRQ-HXUWFJFHSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.70 |
| RefChem:136542 |
| (3R)-7-methoxy-10'-methylspiro(1H-2-benzofuran-3,3'-2-oxatricyclo(6.3.1.04,12)dodeca-1(11),4,6,8(12),9-pentaene)-5'-ol |
| CHEBI:215788 |
| (3R)-7-methoxy-10'-methylspiro[1H-2-benzouran-3,3'-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-5'-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.71% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.08% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.98% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.08% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.86% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.77% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.56% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.86% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.57% | 96.09% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 87.97% | 96.39% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.42% | 91.79% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.00% | 99.23% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 86.23% | 94.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.92% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.69% | 89.00% |
| CHEMBL240 | Q12809 | HERG | 85.50% | 89.76% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.34% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.23% | 91.49% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.56% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.49% | 94.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.51% | 97.21% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.41% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588542 |
| LOTUS | LTS0073755 |
| wikiData | Q105326502 |