Elatoside G
Internal ID | 0760e061-95d7-4c50-95d8-c8cc9759689e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 6-[[8a-carboxy-8-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)O)O)C)C(=O)O)C |
SMILES (Isomeric) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)O)O)C)C(=O)O)C |
InChI | InChI=1S/C36H56O11/c1-31(2)13-14-36(30(44)45)19(15-31)18-7-8-21-32(3)11-10-23(46-29-26(41)24(39)25(40)27(47-29)28(42)43)33(4,17-37)20(32)9-12-34(21,5)35(18,6)16-22(36)38/h7,19-27,29,37-41H,8-17H2,1-6H3,(H,42,43)(H,44,45) |
InChI Key | UQWJOPVYLXZYCS-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C36H56O11 |
Molecular Weight | 664.80 g/mol |
Exact Mass | 664.38226260 g/mol |
Topological Polar Surface Area (TPSA) | 194.00 Ų |
XlogP | 4.30 |
171828-77-6 |
CHEBI:190331 |
DTXSID801121081 |
(3beta,4alpha,16alpha)-17-Carboxy-16,23-dihydroxy-28-norolean-12-en-3-yl beta-D-glucopyranosiduronic acid |
6-[[8a-carboxy-8-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.41% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.40% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.51% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.27% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.11% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.41% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.11% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.91% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.01% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.72% | 97.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.05% | 99.17% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.95% | 91.07% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.87% | 92.62% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.29% | 97.36% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.86% | 93.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.59% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aralia elata |
PubChem | 85149756 |
LOTUS | LTS0024302 |
wikiData | Q105277559 |