Elaeocarpidine
| Internal ID | bb84718f-49db-4f25-b60d-404758e5d5a6 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | (1S,14S)-3,13,18-triazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H21N3/c1-2-5-14-12(4-1)13-7-11-20-15(17(13)18-14)8-10-19-9-3-6-16(19)20/h1-2,4-5,15-16,18H,3,6-11H2/t15-,16-/m0/s1 |
| InChI Key | MQDDWIVNNZPOCB-HOTGVXAUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.173547683 g/mol |
| Topological Polar Surface Area (TPSA) | 22.30 Ų |
| XlogP | 2.80 |
| 20069-07-2 |
| NSC608986 |
| (1S,14S)-3,13,18-triazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene |
| NSC-608986 |
| C10590 |
| CHEBI:4765 |
| SCHEMBL30229697 |
| DTXSID601108372 |
| 77646-17-4 |
| Q27106469 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 98.76% | 89.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.90% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.59% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.55% | 93.40% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.39% | 88.56% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 92.26% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 89.89% | 91.43% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.62% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.94% | 96.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.75% | 95.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.24% | 93.99% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 86.35% | 91.76% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.43% | 95.62% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.33% | 92.98% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.86% | 94.45% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.69% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.64% | 95.89% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 82.63% | 95.48% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.52% | 92.67% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.01% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tarenna vanprukii |
| PubChem | 355436 |
| LOTUS | LTS0112269 |
| wikiData | Q27106469 |