Efrapeptin J
| Internal ID | 79605246-58be-4089-af63-a5c090695101 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 1-acetyl-N-[1-[2-[[1-[[1-[[1-[[3-[[2-[[1-[[1-[2-[[1-[[1-[[1-[[1-[[1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-methyl-1-oxopropan-2-yl]piperidine-2-carboxamide |
| SMILES (Canonical) | CC(C)CC(CN1CCC[N+]2=C1CCC2)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCCN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)CNC(=O)CCNC(=O)C(CC(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C4CCCCN4C(=O)C(C)(C)NC(=O)C5CCCCN5C(=O)C |
| SMILES (Isomeric) | CC(C)CC(CN1CCC[N+]2=C1CCC2)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCCN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)CNC(=O)CCNC(=O)C(CC(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C4CCCCN4C(=O)C(C)(C)NC(=O)C5CCCCN5C(=O)C |
| InChI | InChI=1S/C81H138N18O16/c1-48(2)43-53(47-96-39-30-38-95-37-29-34-61(95)96)85-69(110)76(11,12)89-64(105)55(45-50(5)6)86-62(103)51(7)84-68(109)75(9,10)90-66(107)57-32-25-28-42-99(57)74(115)81(21,22)94-71(112)78(15,16)88-60(102)46-83-59(101)35-36-82-63(104)54(44-49(3)4)87-70(111)77(13,14)93-72(113)79(17,18)91-67(108)58-33-24-27-41-98(58)73(114)80(19,20)92-65(106)56-31-23-26-40-97(56)52(8)100/h48-51,53-58H,23-47H2,1-22H3,(H12-,82,83,84,85,86,87,88,89,90,91,92,93,94,101,102,103,104,105,106,107,108,109,110,111,112,113)/p+1 |
| InChI Key | FPZWWNKQAQRXAV-UHFFFAOYSA-O |
| Popularity | 1 reference in papers |
| Molecular Formula | C81H139N18O16+ |
| Molecular Weight | 1621.10 g/mol |
| Exact Mass | 1620.06164542 g/mol |
| Topological Polar Surface Area (TPSA) | 446.00 Ų |
| XlogP | 2.00 |
| Atomic LogP (AlogP) | 1.04 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 37 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6892 | 68.92% |
| Caco-2 | - | 0.8571 | 85.71% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.6215 | 62.15% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8459 | 84.59% |
| OATP1B3 inhibitior | + | 0.9350 | 93.50% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.9439 | 94.39% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8363 | 83.63% |
| CYP3A4 substrate | + | 0.7343 | 73.43% |
| CYP2C9 substrate | - | 0.5996 | 59.96% |
| CYP2D6 substrate | - | 0.8376 | 83.76% |
| CYP3A4 inhibition | - | 0.8964 | 89.64% |
| CYP2C9 inhibition | - | 0.7158 | 71.58% |
| CYP2C19 inhibition | - | 0.7344 | 73.44% |
| CYP2D6 inhibition | - | 0.8566 | 85.66% |
| CYP1A2 inhibition | - | 0.8643 | 86.43% |
| CYP2C8 inhibition | + | 0.6490 | 64.90% |
| CYP inhibitory promiscuity | - | 0.9507 | 95.07% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6414 | 64.14% |
| Eye corrosion | - | 0.9829 | 98.29% |
| Eye irritation | - | 0.8956 | 89.56% |
| Skin irritation | - | 0.7659 | 76.59% |
| Skin corrosion | - | 0.9028 | 90.28% |
| Ames mutagenesis | - | 0.5108 | 51.08% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6543 | 65.43% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5175 | 51.75% |
| skin sensitisation | - | 0.8479 | 84.79% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.6004 | 60.04% |
| Acute Oral Toxicity (c) | III | 0.6068 | 60.68% |
| Estrogen receptor binding | - | 0.4843 | 48.43% |
| Androgen receptor binding | + | 0.7642 | 76.42% |
| Thyroid receptor binding | + | 0.7089 | 70.89% |
| Glucocorticoid receptor binding | + | 0.7835 | 78.35% |
| Aromatase binding | + | 0.7979 | 79.79% |
| PPAR gamma | + | 0.7673 | 76.73% |
| Honey bee toxicity | - | 0.7368 | 73.68% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
| Fish aquatic toxicity | + | 0.6859 | 68.59% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.04% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.93% | 98.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.49% | 98.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.58% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.47% | 98.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.52% | 93.56% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 95.31% | 90.93% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 95.14% | 96.31% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.98% | 95.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.73% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.61% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.11% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.89% | 90.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.83% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.48% | 93.10% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 91.38% | 93.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 91.33% | 96.67% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 91.29% | 94.50% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 90.56% | 89.33% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.36% | 97.23% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.82% | 97.64% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.65% | 97.21% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 89.60% | 91.65% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.23% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.15% | 94.45% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 88.55% | 94.05% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 87.93% | 95.52% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.67% | 94.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.66% | 90.08% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 86.45% | 92.12% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.10% | 96.28% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.00% | 99.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.88% | 96.47% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.79% | 95.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 85.77% | 99.35% |
| CHEMBL5028 | O14672 | ADAM10 | 85.76% | 97.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.60% | 97.50% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.96% | 90.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.47% | 92.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 84.30% | 96.61% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 84.17% | 99.77% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.80% | 96.33% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.59% | 83.10% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 83.39% | 98.94% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.32% | 96.25% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.18% | 93.04% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.09% | 96.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.97% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.97% | 99.17% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.37% | 94.00% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 81.96% | 93.90% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.90% | 95.27% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.85% | 97.09% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.80% | 97.56% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 81.67% | 88.81% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.66% | 90.00% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 81.54% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.08% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.45% | 93.03% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 80.42% | 98.33% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 80.38% | 83.14% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 80.34% | 92.80% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.00% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74368875 |
| LOTUS | LTS0246996 |
| wikiData | Q104166668 |