Efrapeptin E
| Internal ID | 17dca8a3-f6aa-4699-9a84-6de438240f9a |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-1-acetyl-N-[1-[(2S)-2-[[(2S)-1-[[1-[[(2S)-1-[[3-[[2-[[1-[[1-[(2S)-2-[[1-[[2-[[(2S)-1-[[(2S)-1-[[(2S)-1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]amino]-2-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]carbamoyl]piperidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxobutan-2-yl]carbamoyl]piperidin-1-yl]-2-methyl-1-oxopropan-2-yl]piperidine-2-carboxamide |
| SMILES (Canonical) | CCC(C)(C(=O)NC(CC(C)C)CN1CCC[N+]2=C1CCC2)NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(C)(C)NC(=O)C3CCCCN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)CNC(=O)CCNC(=O)C(CC(C)C)NC(=O)C(C)(C)NC(=O)C(C)(CC)NC(=O)C4CCCCN4C(=O)C(C)(C)NC(=O)C5CCCCN5C(=O)C |
| SMILES (Isomeric) | CC[C@@](C)(C(=O)N[C@@H](CC(C)C)CN1CCC[N+]2=C1CCC2)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)C(C)(C)NC(=O)[C@@H]3CCCCN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)CNC(=O)CCNC(=O)[C@H](CC(C)C)NC(=O)C(C)(C)NC(=O)[C@](C)(CC)NC(=O)[C@@H]4CCCCN4C(=O)C(C)(C)NC(=O)[C@@H]5CCCCN5C(=O)C |
| InChI | InChI=1S/C82H140N18O16/c1-22-81(20,72(113)86-54(44-50(3)4)49-97-40-31-39-96-38-30-35-63(96)97)92-65(106)56(46-52(7)8)87-61(103)47-85-69(110)76(10,11)90-67(108)58-33-25-28-42-99(58)75(116)80(18,19)94-71(112)78(14,15)89-62(104)48-84-60(102)36-37-83-64(105)55(45-51(5)6)88-70(111)77(12,13)95-73(114)82(21,23-2)93-68(109)59-34-26-29-43-100(59)74(115)79(16,17)91-66(107)57-32-24-27-41-98(57)53(9)101/h50-52,54-59H,22-49H2,1-21H3,(H12-,83,84,85,86,87,88,89,90,91,92,93,94,95,102,103,104,105,106,107,108,109,110,111,112,113,114)/p+1/t54-,55-,56-,57-,58-,59-,81-,82-/m0/s1 |
| InChI Key | FRUCGMNQTOGSLR-XPFFFHCNSA-O |
| Popularity | 0 references in papers |
| Molecular Formula | C82H141N18O16+ |
| Molecular Weight | 1635.10 g/mol |
| Exact Mass | 1634.07729548 g/mol |
| Topological Polar Surface Area (TPSA) | 446.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 1.44 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 39 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8016 | 80.16% |
| Caco-2 | - | 0.8569 | 85.69% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Lysosomes | 0.6376 | 63.76% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8373 | 83.73% |
| OATP1B3 inhibitior | + | 0.9340 | 93.40% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.9430 | 94.30% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8365 | 83.65% |
| CYP3A4 substrate | + | 0.7370 | 73.70% |
| CYP2C9 substrate | - | 0.5996 | 59.96% |
| CYP2D6 substrate | - | 0.8376 | 83.76% |
| CYP3A4 inhibition | - | 0.8332 | 83.32% |
| CYP2C9 inhibition | - | 0.7100 | 71.00% |
| CYP2C19 inhibition | - | 0.7304 | 73.04% |
| CYP2D6 inhibition | - | 0.8530 | 85.30% |
| CYP1A2 inhibition | - | 0.8592 | 85.92% |
| CYP2C8 inhibition | + | 0.7349 | 73.49% |
| CYP inhibitory promiscuity | - | 0.9388 | 93.88% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6432 | 64.32% |
| Eye corrosion | - | 0.9827 | 98.27% |
| Eye irritation | - | 0.8956 | 89.56% |
| Skin irritation | - | 0.7678 | 76.78% |
| Skin corrosion | - | 0.9000 | 90.00% |
| Ames mutagenesis | + | 0.5092 | 50.92% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6543 | 65.43% |
| Micronuclear | + | 0.7400 | 74.00% |
| Hepatotoxicity | + | 0.5425 | 54.25% |
| skin sensitisation | - | 0.8490 | 84.90% |
| Respiratory toxicity | + | 0.6778 | 67.78% |
| Reproductive toxicity | + | 0.8222 | 82.22% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.7243 | 72.43% |
| Acute Oral Toxicity (c) | III | 0.6044 | 60.44% |
| Estrogen receptor binding | + | 0.5304 | 53.04% |
| Androgen receptor binding | + | 0.7712 | 77.12% |
| Thyroid receptor binding | + | 0.7034 | 70.34% |
| Glucocorticoid receptor binding | + | 0.7883 | 78.83% |
| Aromatase binding | + | 0.8038 | 80.38% |
| PPAR gamma | + | 0.7731 | 77.31% |
| Honey bee toxicity | - | 0.7360 | 73.60% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | + | 0.6700 | 67.00% |
| Fish aquatic toxicity | + | 0.7585 | 75.85% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.77% | 95.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.69% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.41% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.28% | 98.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.65% | 98.10% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.39% | 98.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.94% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.65% | 93.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.25% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.99% | 91.19% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.39% | 90.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.84% | 100.00% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 91.42% | 94.05% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.42% | 97.21% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.31% | 93.10% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.73% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.65% | 94.45% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 89.88% | 90.24% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.52% | 83.10% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 88.86% | 93.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.84% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 88.37% | 89.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.26% | 91.11% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 88.19% | 83.14% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.90% | 99.35% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.09% | 92.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.94% | 100.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.86% | 90.93% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 86.76% | 96.31% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 86.68% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.60% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.43% | 94.33% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.41% | 96.28% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.20% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.92% | 96.95% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 85.90% | 88.81% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.80% | 97.64% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.56% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.56% | 99.23% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.33% | 95.17% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.85% | 95.52% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.83% | 96.47% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.47% | 95.27% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 84.18% | 91.65% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 83.88% | 97.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.53% | 90.08% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.51% | 94.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 83.38% | 98.94% |
| CHEMBL5028 | O14672 | ADAM10 | 83.15% | 97.50% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 83.14% | 95.34% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.76% | 93.04% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.68% | 89.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.56% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.22% | 96.90% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.95% | 98.75% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.85% | 96.33% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.67% | 96.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.22% | 93.03% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 81.05% | 99.77% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 80.90% | 97.09% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.80% | 89.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.79% | 96.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.76% | 97.56% |
| CHEMBL3691 | Q13822 | Autotaxin | 80.46% | 96.39% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 80.09% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101090518 |
| LOTUS | LTS0261882 |
| wikiData | Q105000432 |