(15S)-11,19,20-trihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17,19,21-octaen-13-one
| Internal ID | a0a47145-ea21-464c-a79f-8837da029c29 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | (15S)-11,19,20-trihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17,19,21-octaen-13-one |
| SMILES (Canonical) | CC(=CC1C2=C(C3=CC(=C(C=C3O1)O)O)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
| SMILES (Isomeric) | CC(=C[C@H]1C2=C(C3=CC(=C(C=C3O1)O)O)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
| InChI | InChI=1S/C25H22O7/c1-11(2)7-19-21-22(29)20-16(28)10-18-12(5-6-25(3,4)32-18)23(20)31-24(21)13-8-14(26)15(27)9-17(13)30-19/h5-10,19,26-28H,1-4H3/t19-/m0/s1 |
| InChI Key | SUXAIEIHGDSOAY-IBGZPJMESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13655304 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
![2D Structure of (15S)-11,19,20-trihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17,19,21-octaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/efb50c80-864a-11ee-b76e-1171692d69ef.jpg "2D Structure of (15S)-11,19,20-trihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17,19,21-octaen-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.72% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.71% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.36% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.94% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.42% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.08% | 94.73% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.08% | 94.42% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.61% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.64% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.62% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.13% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.10% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aloe secundiflora |
| Ancistrocladus abbreviatus |
| Artocarpus chama |
| Artocarpus kemando |
| PubChem | 162987165 |
| LOTUS | LTS0163815 |
| wikiData | Q105203945 |