[(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 1e0694a1-7cec-4c30-a859-3a6e66aafeed |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)O)O)OC(=O)C=CC6=CC=C(C=C6)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C\C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)O)O)OC(=O)/C=C/C6=CC=C(C=C6)O)O |
InChI | InChI=1S/C39H32O14/c40-24-9-1-21(2-10-24)5-15-33(45)49-20-32-38(53-34(46)16-6-22-3-11-25(41)12-4-22)36(47)37(48)39(52-32)50-27-17-28(43)35-29(44)19-30(51-31(35)18-27)23-7-13-26(42)14-8-23/h1-19,32,36-43,47-48H,20H2/b15-5-,16-6+/t32-,36-,37-,38-,39-/m1/s1 |
InChI Key | DMAQFLQMQDZICP-LMIKHVAYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H32O14 |
Molecular Weight | 724.70 g/mol |
Exact Mass | 724.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 4.90 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/07/eef75030-25b0-11ee-b998-4fd8e31c67bc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.44% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.97% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 97.45% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.24% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.23% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.32% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.89% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.08% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.05% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.59% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.50% | 95.78% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.11% | 97.28% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.62% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.29% | 94.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 86.24% | 98.35% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.08% | 91.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.06% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.78% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.48% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.69% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.68% | 95.64% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.06% | 83.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.50% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.38% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycopodiella cernua |