4-[[(1R,2S,8R,9R,10S,12R,13R,14S,17S,19R,20S,21R,23Z)-9,21-dihydroxy-9-[(E)-4-hydroxy-3-methylbut-2-enoyl]oxy-23-(1-methoxy-1-oxopropan-2-ylidene)-13,20-dimethyl-4,22-dioxo-3-oxaoctacyclo[14.7.1.02,6.02,14.08,13.010,12.017,19.020,24]tetracosa-5,16(24)-dien-5-yl]oxy]-4-oxobutanoic acid
Internal ID | e314741e-9fab-4333-a67b-5945f095e4c0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | 4-[[(1R,2S,8R,9R,10S,12R,13R,14S,17S,19R,20S,21R,23Z)-9,21-dihydroxy-9-[(E)-4-hydroxy-3-methylbut-2-enoyl]oxy-23-(1-methoxy-1-oxopropan-2-ylidene)-13,20-dimethyl-4,22-dioxo-3-oxaoctacyclo[14.7.1.02,6.02,14.08,13.010,12.017,19.020,24]tetracosa-5,16(24)-dien-5-yl]oxy]-4-oxobutanoic acid |
SMILES (Canonical) | CC(=CC(=O)OC1(C2CC2C3(C1CC4=C(C(=O)OC45C3CC6=C7C5C(=C(C)C(=O)OC)C(=O)C(C7(C8C6C8)C)O)OC(=O)CCC(=O)O)C)O)CO |
SMILES (Isomeric) | C/C(=C\C(=O)O[C@@]1([C@H]2C[C@H]2[C@]3([C@H]1CC4=C(C(=O)O[C@]45[C@H]3CC6=C7[C@@H]5/C(=C(\C)/C(=O)OC)/C(=O)[C@@H]([C@]7([C@H]8[C@@H]6C8)C)O)OC(=O)CCC(=O)O)C)O)/CO |
InChI | InChI=1S/C38H42O14/c1-14(13-39)8-26(43)51-38(48)20-11-19(20)35(3)22-10-17-16-9-18(16)36(4)28(17)29(27(30(44)32(36)45)15(2)33(46)49-5)37(22)21(12-23(35)38)31(34(47)52-37)50-25(42)7-6-24(40)41/h8,16,18-20,22-23,29,32,39,45,48H,6-7,9-13H2,1-5H3,(H,40,41)/b14-8+,27-15-/t16-,18-,19-,20+,22+,23-,29+,32+,35-,36+,37+,38-/m1/s1 |
InChI Key | AWMOJZCOHADKON-NTIDOFDSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H42O14 |
Molecular Weight | 722.70 g/mol |
Exact Mass | 722.25745601 g/mol |
Topological Polar Surface Area (TPSA) | 220.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.51% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.81% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.65% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.28% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.06% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.06% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.27% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.24% | 91.19% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.95% | 83.82% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.64% | 99.23% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.59% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.48% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.56% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.77% | 89.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.58% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus fortunei |
PubChem | 101865173 |
LOTUS | LTS0083720 |
wikiData | Q104920134 |