2-[2-[3,5-Dihydroxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one
Internal ID | 8292b212-a3e4-4cf6-bb62-e7d750500448 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | 2-[2-[3,5-dihydroxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C(C=C2)O)C3CC(=O)C4=C(C=C(C=C4O3)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(C=C(C=C2)O)C3CC(=O)C4=C(C=C(C=C4O3)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
InChI | InChI=1S/C27H32O15/c1-9-20(33)25(42-26-23(36)22(35)21(34)18(8-28)41-26)24(37)27(38-9)40-15-3-2-10(29)4-12(15)16-7-14(32)19-13(31)5-11(30)6-17(19)39-16/h2-6,9,16,18,20-31,33-37H,7-8H2,1H3 |
InChI Key | JTQOVBLCPLYXBN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H32O15 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of 2-[2-[3,5-Dihydroxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one 2D Structure of 2-[2-[3,5-Dihydroxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/eeb44460-855e-11ee-82dd-7b371e131d7e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.36% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.82% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.18% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.78% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.62% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.43% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.16% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.42% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.57% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.70% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.47% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.64% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.90% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.44% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.22% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.47% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.12% | 96.21% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.64% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.56% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thelypteris acuminata |
PubChem | 73172757 |
LOTUS | LTS0075133 |
wikiData | Q105134939 |