(2R,3S,5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R)-3,4-dihydroxy-6,6-dimethyl-5-methylideneheptan-2-yl]-2,3-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one
Internal ID | c99ce975-d6ed-42b5-93b4-2ed7928f8663 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Tetrahydroxy bile acids, alcohols and derivatives |
IUPAC Name | (2R,3S,5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R)-3,4-dihydroxy-6,6-dimethyl-5-methylideneheptan-2-yl]-2,3-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
SMILES (Canonical) | CC(C1CCC2C1(CCC3C2CC(=O)C4C3(CC(C(C4)O)O)C)C)C(C(C(=C)C(C)(C)C)O)O |
SMILES (Isomeric) | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)[C@@H]4[C@@]3(C[C@H]([C@H](C4)O)O)C)C)[C@H]([C@@H](C(=C)C(C)(C)C)O)O |
InChI | InChI=1S/C29H48O5/c1-15(25(33)26(34)16(2)27(3,4)5)18-8-9-19-17-12-22(30)21-13-23(31)24(32)14-29(21,7)20(17)10-11-28(18,19)6/h15,17-21,23-26,31-34H,2,8-14H2,1,3-7H3/t15-,17-,18+,19-,20-,21+,23-,24+,25+,26+,28+,29+/m0/s1 |
InChI Key | HAOQPQZVDMAOKT-SBQKBANHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H48O5 |
Molecular Weight | 476.70 g/mol |
Exact Mass | 476.35017463 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 5.10 |
DTXSID601313888 |
111618-87-2 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.95% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.33% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.25% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.01% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.75% | 97.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 93.44% | 85.31% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.69% | 85.14% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 91.15% | 97.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.82% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.57% | 93.04% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.57% | 94.45% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.29% | 96.43% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.07% | 97.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.94% | 96.38% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.23% | 97.79% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.96% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.56% | 95.56% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.92% | 98.05% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.59% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.23% | 89.34% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.19% | 98.10% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.77% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.76% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.49% | 93.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.21% | 82.69% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.18% | 96.61% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.14% | 98.03% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.91% | 100.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.80% | 95.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.70% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.52% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.60% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phaseolus vulgaris |
PubChem | 13991216 |
LOTUS | LTS0081106 |
wikiData | Q105024965 |