(1R,4E,6R,8R,10E,14R)-1,5,11-trimethyl-8-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-ol
| Internal ID | de356186-5614-4a51-a753-4d0163f0ebb9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Cembrane diterpenoids |
| IUPAC Name | (1R,4E,6R,8R,10E,14R)-1,5,11-trimethyl-8-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-ol |
| SMILES (Canonical) | CC1=CCC(CC(C(=CCCC2(C(O2)CC1)C)C)O)C(=C)C |
| SMILES (Isomeric) | C/C/1=C\C[C@H](C[C@H](/C(=C/CC[C@@]2([C@H](O2)CC1)C)/C)O)C(=C)C |
| InChI | InChI=1S/C20H32O2/c1-14(2)17-10-8-15(3)9-11-19-20(5,22-19)12-6-7-16(4)18(21)13-17/h7-8,17-19,21H,1,6,9-13H2,2-5H3/b15-8+,16-7+/t17-,18-,19-,20-/m1/s1 |
| InChI Key | HHMNSEUJBOVFCF-KDNSCCTMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of (1R,4E,6R,8R,10E,14R)-1,5,11-trimethyl-8-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/ee7a6ea0-83af-11ee-ac79-e5c2d20f80a0.jpg "2D Structure of (1R,4E,6R,8R,10E,14R)-1,5,11-trimethyl-8-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.82% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.84% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.07% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.77% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.32% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.93% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.69% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.78% | 95.89% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.32% | 89.63% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.23% | 97.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.79% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.90% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.58% | 90.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.01% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10756928 |
| LOTUS | LTS0206475 |
| wikiData | Q105028381 |