(2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,7S,8R,9S,12S,13S,15R,16R,18S)-6,15-dihydroxy-7,9,13-trimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 768a7d07-4403-4a0a-b8b7-638c8a0034c3 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,7S,8R,9S,12S,13S,15R,16R,18S)-6,15-dihydroxy-7,9,13-trimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)COC7C(C(C(CO7)O)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)O)O)C)C)OC1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
InChI | InChI=1S/C44H74O19/c1-18(15-57-40-37(54)34(51)32(49)28(14-45)61-40)7-10-44(56)19(2)30-27(63-44)12-23-21-6-5-20-11-26(24(46)13-43(20,4)22(21)8-9-42(23,30)3)60-41-38(55)35(52)33(50)29(62-41)17-59-39-36(53)31(48)25(47)16-58-39/h18-41,45-56H,5-17H2,1-4H3/t18-,19-,20-,21+,22-,23-,24+,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35-,36+,37+,38+,39-,40+,41+,42-,43-,44?/m0/s1 |
InChI Key | TVNGRDSDHVARNR-JHGCWHEKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H74O19 |
Molecular Weight | 907.00 g/mol |
Exact Mass | 906.48243013 g/mol |
Topological Polar Surface Area (TPSA) | 307.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
CHEMBL204 | P00734 | Thrombin | 97.05% | 96.01% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.89% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.85% | 95.93% |
CHEMBL220 | P22303 | Acetylcholinesterase | 96.78% | 94.45% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.67% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.75% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.56% | 96.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.20% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.98% | 90.17% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 93.78% | 93.18% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.64% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.70% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.04% | 89.05% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.83% | 98.10% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.65% | 97.79% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.39% | 95.36% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.67% | 96.43% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 87.88% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.83% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.59% | 95.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.29% | 97.93% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.02% | 96.47% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.78% | 98.05% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.74% | 95.89% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 86.15% | 87.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.14% | 96.77% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.25% | 99.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.15% | 100.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.11% | 97.86% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.61% | 92.32% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.78% | 97.29% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.07% | 95.38% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.98% | 96.67% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.49% | 97.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.39% | 92.50% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.02% | 92.78% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.54% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.43% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.53% | 95.83% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.33% | 99.17% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.13% | 80.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Blumea balsamifera |
Trigonella foenum-graecum |
PubChem | 10581588 |
LOTUS | LTS0222828 |
wikiData | Q105379787 |