(2R,3S,4S,4aS,6aS,6bR,8aR,11R,12R,12aS,14aR,14bR)-3-[(2R,3R,4S,4aS,6aS,6bR,8aR,11R,12R,12aS,14aR,14bR)-8a-[(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxycarbonyl-2,3,12-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicene-4-carbonyl]oxy-2,12-dihydroxy-4-(hydroxymethyl)-6a,6b,11,12,14b-pentamethyl-8a-[[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicene-4-carboxylic acid
| Internal ID | 17cc51f9-176f-451a-b148-bf63cec17b60 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | (2R,3S,4S,4aS,6aS,6bR,8aR,11R,12R,12aS,14aR,14bR)-3-[(2R,3R,4S,4aS,6aS,6bR,8aR,11R,12R,12aS,14aR,14bR)-8a-[(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxycarbonyl-2,3,12-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicene-4-carbonyl]oxy-2,12-dihydroxy-4-(hydroxymethyl)-6a,6b,11,12,14b-pentamethyl-8a-[[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicene-4-carboxylic acid |
| SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(CO)C(=O)O)OC(=O)C6(C7CCC8(C(C7(CC(C6O)O)C)CC=C9C8(CCC3(C9C(C(CC3)C)(C)O)C(=O)OC3C(C(C(C(O3)CO)O)OC)O)C)C)C)O)C)C)C2C1(C)O)C)COC1C(C(C(C(O1)COC)O)O)O |
| SMILES (Isomeric) | C[C@@H]1CC[C@]2(CC[C@]3(C(=CC[C@H]4[C@@]3(CC[C@H]5[C@@]4(C[C@H]([C@H]([C@]5(CO)C(=O)O)OC(=O)[C@]6([C@H]7CC[C@]8([C@@H]([C@]7(C[C@H]([C@@H]6O)O)C)CC=C9[C@@]8(CC[C@]3([C@H]9[C@]([C@@H](CC3)C)(C)O)C(=O)O[C@@H]3[C@@H]([C@H]([C@H]([C@@H](O3)CO)O)OC)O)C)C)C)O)C)C)[C@@H]2[C@]1(C)O)C)CO[C@@H]1[C@@H]([C@H]([C@H]([C@@H](O1)COC)O)O)O |
| InChI | InChI=1S/C74H116O23/c1-36-18-24-72(35-93-58-51(82)50(81)48(79)43(95-58)33-91-12)28-26-65(5)38(54(72)70(36,10)89)14-16-45-64(4)31-41(78)57(74(34-76,60(85)86)47(64)21-23-68(45,65)8)96-61(87)69(9)46-20-22-67(7)44(63(46,3)30-40(77)56(69)84)17-15-39-55-71(11,90)37(2)19-25-73(55,29-27-66(39,67)6)62(88)97-59-52(83)53(92-13)49(80)42(32-75)94-59/h14-15,36-37,40-59,75-84,89-90H,16-35H2,1-13H3,(H,85,86)/t36-,37-,40-,41-,42+,43+,44-,45-,46+,47+,48+,49+,50+,51-,52-,53+,54-,55-,56+,57-,58+,59-,63-,64-,65+,66+,67+,68+,69+,70-,71-,72+,73-,74-/m1/s1 |
| InChI Key | ZZZRFGBXMQQWEZ-QXNQRSBWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C74H116O23 |
| Molecular Weight | 1373.70 g/mol |
| Exact Mass | 1372.79073994 g/mol |
| Topological Polar Surface Area (TPSA) | 379.00 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.72% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.96% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.69% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.66% | 94.45% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.19% | 97.36% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.15% | 95.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.87% | 92.50% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.74% | 96.77% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.21% | 93.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.89% | 96.61% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.15% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.37% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.27% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.72% | 95.93% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.62% | 95.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.31% | 96.90% |
| CHEMBL5028 | O14672 | ADAM10 | 84.00% | 97.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.94% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.22% | 94.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.11% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.71% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.24% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rubus pungens |
| PubChem | 101057268 |
| LOTUS | LTS0211989 |
| wikiData | Q105387222 |