(3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxy-2-methylphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan
Internal ID | 21e2f6ec-2e08-4dcf-84a3-01db5114f174 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | (3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxy-2-methylphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
SMILES (Canonical) | CC1=C(C(=C(C=C1C2C3COC(C3CO2)C4=CC(=C(C=C4)OC)OC)OC)OC)OC |
SMILES (Isomeric) | CC1=C(C(=C(C=C1[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)OC)OC)OC)OC)OC |
InChI | InChI=1S/C24H30O7/c1-13-15(10-20(27-4)24(29-6)21(13)28-5)23-17-12-30-22(16(17)11-31-23)14-7-8-18(25-2)19(9-14)26-3/h7-10,16-17,22-23H,11-12H2,1-6H3/t16-,17-,22+,23+/m0/s1 |
InChI Key | NAYZFNHRASGLRI-ZCVTWQBDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H30O7 |
Molecular Weight | 430.50 g/mol |
Exact Mass | 430.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.67% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.45% | 89.62% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 91.42% | 92.98% |
CHEMBL2535 | P11166 | Glucose transporter | 90.42% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.39% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.69% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.43% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.45% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.77% | 91.11% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.10% | 94.03% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.38% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.32% | 94.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.51% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.39% | 89.00% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.64% | 85.49% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.32% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia biondii |
PubChem | 163017051 |
LOTUS | LTS0236546 |
wikiData | Q105176656 |