methyl 2-[(1R,2S,5R,6R,11R,13S,14R)-14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-16-yl]acetate
Internal ID | 2826c4dc-b222-4224-bfd2-6123b42af9b4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | methyl 2-[(1R,2S,5R,6R,11R,13S,14R)-14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-16-yl]acetate |
SMILES (Canonical) | CC(=O)OC1C2CC3C(CCC4(C3=CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@@H]2C[C@@H]3[C@H](CC[C@@]4(C3=CC(=O)O[C@H]4C5=COC=C5)C)[C@@](C2=O)(C(C1(C)C)CC(=O)OC)C |
InChI | InChI=1S/C29H36O8/c1-15(30)36-26-18-11-17-19(29(5,24(18)33)21(27(26,2)3)13-22(31)34-6)7-9-28(4)20(17)12-23(32)37-25(28)16-8-10-35-14-16/h8,10,12,14,17-19,21,25-26H,7,9,11,13H2,1-6H3/t17-,18-,19+,21?,25+,26-,28-,29-/m1/s1 |
InChI Key | XOTNOFJPJBDOJJ-FPSCXZSDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H36O8 |
Molecular Weight | 512.60 g/mol |
Exact Mass | 512.24101810 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.79% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.70% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.60% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.01% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.02% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.57% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.45% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.50% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.34% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.25% | 94.80% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.14% | 94.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.46% | 99.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.79% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.47% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.37% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.34% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.92% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.55% | 90.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.25% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 80.50% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela fissilis |
PubChem | 162889909 |
LOTUS | LTS0053133 |
wikiData | Q105337915 |