[17-[5-[4-(4,5-Dihydroxy-3-methoxyoxan-2-yl)oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methylheptan-2-yl]-3,4,6,8-tetrahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] acetate
| Internal ID | dde52fa1-47f1-4449-8255-4bb4a8e7449d |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [17-[5-[4-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methylheptan-2-yl]-3,4,6,8-tetrahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] acetate |
| SMILES (Canonical) | CC(C)C(CCC(C)C1CC(C2C1(CCC3C2(CC(C4C3(CCC(C4O)O)C)O)O)C)OC(=O)C)OC5C(C(C(O5)CO)OC6C(C(C(CO6)O)O)OC)O |
| SMILES (Isomeric) | CC(C)C(CCC(C)C1CC(C2C1(CCC3C2(CC(C4C3(CCC(C4O)O)C)O)O)C)OC(=O)C)OC5C(C(C(O5)CO)OC6C(C(C(CO6)O)O)OC)O |
| InChI | InChI=1S/C40H68O15/c1-18(2)25(53-36-32(48)33(27(16-41)54-36)55-37-34(50-7)31(47)24(45)17-51-37)9-8-19(3)21-14-26(52-20(4)42)35-38(21,5)13-11-28-39(6)12-10-22(43)30(46)29(39)23(44)15-40(28,35)49/h18-19,21-37,41,43-49H,8-17H2,1-7H3 |
| InChI Key | OTSSQSGFARMFRO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H68O15 |
| Molecular Weight | 789.00 g/mol |
| Exact Mass | 788.45582146 g/mol |
| Topological Polar Surface Area (TPSA) | 234.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
![2D Structure of [17-[5-[4-(4,5-Dihydroxy-3-methoxyoxan-2-yl)oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methylheptan-2-yl]-3,4,6,8-tetrahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ee0c8480-859e-11ee-947a-ff8b32a4d920.jpg "2D Structure of [17-[5-[4-(4,5-Dihydroxy-3-methoxyoxan-2-yl)oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methylheptan-2-yl]-3,4,6,8-tetrahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.49% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.09% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.19% | 94.45% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.14% | 95.58% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.05% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.28% | 97.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.21% | 91.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.01% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.34% | 98.95% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 90.61% | 97.28% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.59% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.20% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.37% | 97.29% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.92% | 96.77% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.73% | 95.71% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 86.67% | 95.36% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.10% | 93.18% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.97% | 94.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.96% | 92.88% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.81% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.46% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.34% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.15% | 98.10% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.65% | 92.78% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.38% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.33% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.14% | 91.07% |
| CHEMBL5028 | O14672 | ADAM10 | 83.61% | 97.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.02% | 92.86% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.37% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.33% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.17% | 98.75% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.74% | 97.79% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.17% | 92.62% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.91% | 96.61% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.85% | 94.97% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.70% | 97.93% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.61% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74000176 |
| LOTUS | LTS0055414 |
| wikiData | Q105199813 |