[(1S,3R,13S,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,19,21,22,24-pentaacetyloxy-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl]methyl acetate
Internal ID | f6d1c7ef-6fdc-49ba-b26f-74ea12baa036 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(1S,3R,13S,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,19,21,22,24-pentaacetyloxy-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl]methyl acetate |
SMILES (Canonical) | CC1C(C(=O)OC2C(C(C3(C(C(C4C(C3(C2(C)O)OC4(COC(=O)C5=C1C=CN=C5)C)OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
SMILES (Isomeric) | C[C@H]1[C@@H](C(=O)O[C@H]2[C@@H]([C@@H]([C@]3([C@@H]([C@@H]([C@@H]4[C@H]([C@@]3([C@@]2(C)O)O[C@]4(COC(=O)C5=C1C=CN=C5)C)OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
InChI | InChI=1S/C38H47NO18/c1-16-17(2)33(46)56-30-28(52-20(5)42)32(55-23(8)45)37(15-49-18(3)40)31(54-22(7)44)27(51-19(4)41)26-29(53-21(6)43)38(37,36(30,10)48)57-35(26,9)14-50-34(47)25-13-39-12-11-24(16)25/h11-13,16-17,26-32,48H,14-15H2,1-10H3/t16-,17-,26+,27+,28-,29+,30-,31+,32-,35-,36-,37+,38-/m0/s1 |
InChI Key | XVCIECFQBMGYAF-YJBNGYBOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H47NO18 |
Molecular Weight | 805.80 g/mol |
Exact Mass | 805.27931365 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of [(1S,3R,13S,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,19,21,22,24-pentaacetyloxy-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl]methyl acetate 2D Structure of [(1S,3R,13S,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,19,21,22,24-pentaacetyloxy-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/edf7f820-8680-11ee-bdb5-ed658ddf36ff.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.20% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.93% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.04% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.01% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.95% | 97.79% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.99% | 91.11% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.35% | 91.24% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.74% | 82.69% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.55% | 81.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.29% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.21% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.09% | 94.80% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.63% | 91.07% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.06% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.96% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.71% | 97.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.76% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.81% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.29% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.17% | 95.56% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 82.11% | 92.51% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.11% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.29% | 97.28% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.11% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Peritassa laevigata |
PubChem | 138857801 |
LOTUS | LTS0131895 |
wikiData | Q105342789 |