5,7-Dihydroxy-2-(4-hydroxyphenyl)-3,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one
Internal ID | 4790795a-cd5e-414b-b079-2e7bec6de567 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
InChI | InChI=1S/C27H30O17/c28-6-12-15(32)19(36)21(38)26(41-12)43-24-10(31)5-11-14(17(24)34)18(35)25(23(40-11)8-1-3-9(30)4-2-8)44-27-22(39)20(37)16(33)13(7-29)42-27/h1-5,12-13,15-16,19-22,26-34,36-39H,6-7H2 |
InChI Key | GIHCVNUAKOTVCJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O17 |
Molecular Weight | 626.50 g/mol |
Exact Mass | 626.14829948 g/mol |
Topological Polar Surface Area (TPSA) | 286.00 Ų |
XlogP | -1.40 |
FT-0775411 |
B0005-479853 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.35% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.26% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.85% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.72% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.57% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.60% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.22% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.27% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.52% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 87.08% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.00% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.23% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.43% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.95% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.78% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.42% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.23% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
PubChem | 14375136 |
LOTUS | LTS0155086 |
wikiData | Q105008975 |