[(2S,3S,4S,5R,6S)-4-acetyloxy-6-[(2R,3R,4R,5S,6S)-3,5-diacetyloxy-2-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxan-4-yl]oxy-5-hydroxy-2-methyloxan-3-yl] acetate
Internal ID | 26a2f5e8-5b43-425b-8f4a-abbeace4a4bd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(2S,3S,4S,5R,6S)-4-acetyloxy-6-[(2R,3R,4R,5S,6S)-3,5-diacetyloxy-2-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxan-4-yl]oxy-5-hydroxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C)OCC3C(C(C(C(O3)OC4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O)O)O)C)OC(=O)C)O)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@H]([C@@H]2OC(=O)C)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O)O)O)C)OC(=O)C)O)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C41H48O23/c1-14-32(57-16(3)42)36(59-18(5)44)31(53)40(55-14)64-37-33(58-17(4)43)15(2)56-41(38(37)60-19(6)45)54-13-25-27(49)29(51)30(52)39(62-25)63-35-28(50)26-23(48)11-22(47)12-24(26)61-34(35)20-7-9-21(46)10-8-20/h7-12,14-15,25,27,29-33,36-41,46-49,51-53H,13H2,1-6H3/t14-,15-,25+,27+,29-,30+,31+,32-,33-,36-,37+,38+,39-,40-,41+/m0/s1 |
InChI Key | NQHCDXJGFHUQMQ-WCBBADAASA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H48O23 |
Molecular Weight | 908.80 g/mol |
Exact Mass | 908.25863777 g/mol |
Topological Polar Surface Area (TPSA) | 329.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4S,5R,6S)-4-acetyloxy-6-[(2R,3R,4R,5S,6S)-3,5-diacetyloxy-2-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxan-4-yl]oxy-5-hydroxy-2-methyloxan-3-yl] acetate 2D Structure of [(2S,3S,4S,5R,6S)-4-acetyloxy-6-[(2R,3R,4R,5S,6S)-3,5-diacetyloxy-2-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxan-4-yl]oxy-5-hydroxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ede2c610-8601-11ee-877c-4b338e66d209.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.38% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.33% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.51% | 95.64% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.36% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.01% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.98% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.56% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.84% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.70% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.80% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.22% | 94.80% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.04% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.19% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.97% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.10% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.05% | 95.56% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.95% | 94.42% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.91% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia reticulata |
Camellia semiserrata |
PubChem | 102476665 |
LOTUS | LTS0074809 |
wikiData | Q105183868 |