[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] (3S,5R,10S,13R,14S,17R)-3-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-17-[(2R,5R)-5-hydroxy-5,6,6-trimethylheptan-2-yl]-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
| Internal ID | 60f0c940-6857-47dc-af06-b59e1e38997c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] (3S,5R,10S,13R,14S,17R)-3-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-17-[(2R,5R)-5-hydroxy-5,6,6-trimethylheptan-2-yl]-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate |
| SMILES (Canonical) | CC(CCC(C)(C(C)(C)C)O)C1CCC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)NC(=O)C)C)C)C(=O)OC7C(C(C(CO7)O)O)O |
| SMILES (Isomeric) | C[C@H](CC[C@](C)(C(C)(C)C)O)[C@H]1CC[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)NC(=O)C)C)C)C(=O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O |
| InChI | InChI=1S/C51H85NO18/c1-24(13-19-50(10,64)46(3,4)5)26-15-20-51(45(63)70-43-40(62)35(57)29(56)23-65-43)28-11-12-32-47(6,7)33(16-17-48(32,8)27(28)14-18-49(26,51)9)68-44-41(39(61)37(59)31(22-54)67-44)69-42-34(52-25(2)55)38(60)36(58)30(21-53)66-42/h24,26,29-44,53-54,56-62,64H,11-23H2,1-10H3,(H,52,55)/t24-,26-,29-,30-,31-,32+,33+,34-,35+,36-,37+,38-,39+,40-,41-,42+,43+,44+,48-,49-,50-,51+/m1/s1 |
| InChI Key | WESGKDKHWVLOMM-IRJXKVRISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C51H85NO18 |
| Molecular Weight | 1000.20 g/mol |
| Exact Mass | 999.57666486 g/mol |
| Topological Polar Surface Area (TPSA) | 304.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.14% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.24% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.70% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.70% | 95.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.87% | 96.61% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.61% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.29% | 91.24% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.10% | 95.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.95% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.93% | 94.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.79% | 94.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.82% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.30% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.20% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.63% | 99.17% |
| CHEMBL5028 | O14672 | ADAM10 | 88.11% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.92% | 97.14% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.57% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.54% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.27% | 92.50% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 87.03% | 92.78% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.89% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.56% | 89.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.52% | 97.79% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.25% | 96.90% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.14% | 94.45% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.00% | 98.05% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.48% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.03% | 95.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.80% | 96.47% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.39% | 83.82% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.04% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.91% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.80% | 82.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.54% | 95.83% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.31% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.38% | 94.73% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.14% | 98.75% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.63% | 95.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162907142 |
| LOTUS | LTS0222490 |
| wikiData | Q105303450 |