methyl (E)-3-[(2S,4S,6R,7R,8R,9S,10S,14S,17S,19R)-17-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,9-dihydroxy-2,8,10,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-en-7-yl]-2-methylprop-2-enoate
Internal ID | 85e312ad-86b8-424b-924a-77ebb4acb82b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (E)-3-[(2S,4S,6R,7R,8R,9S,10S,14S,17S,19R)-17-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,9-dihydroxy-2,8,10,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-en-7-yl]-2-methylprop-2-enoate |
SMILES (Canonical) | CC1C(C(OC2C1(C3(CCC4=C(C3(C2)C)CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)O)O)C=C(C)C(=O)OC |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](O[C@@H]2[C@]1([C@]3(CCC4=C([C@@]3(C2)C)CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O)O)/C=C(\C)/C(=O)OC |
InChI | InChI=1S/C49H78O20/c1-20(40(59)62-9)16-23-21(2)49(61)30(66-41(23)60)17-47(7)25-10-11-28-45(4,5)29(13-14-46(28,6)24(25)12-15-48(47,49)8)67-43-38(35(56)32(53)26(18-50)64-43)69-44-39(36(57)33(54)27(19-51)65-44)68-42-37(58)34(55)31(52)22(3)63-42/h16,21-23,26-39,41-44,50-58,60-61H,10-15,17-19H2,1-9H3/b20-16+/t21-,22+,23-,26-,27-,28+,29+,30+,31+,32-,33-,34-,35+,36+,37-,38-,39-,41-,42+,43+,44+,46-,47+,48+,49-/m1/s1 |
InChI Key | XSZAGZUZYWEAOL-PFKKLYOFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H78O20 |
Molecular Weight | 987.10 g/mol |
Exact Mass | 986.50864487 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.69% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.51% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.84% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.84% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.91% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.80% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.59% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.12% | 91.24% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.12% | 90.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.40% | 94.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.99% | 92.94% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.92% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.58% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.49% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.84% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 84.65% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.00% | 94.73% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.93% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.84% | 95.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.54% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.34% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.91% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.82% | 97.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.32% | 96.61% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.08% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scilla peruviana |
PubChem | 162916137 |
LOTUS | LTS0170209 |
wikiData | Q105341379 |