(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9S,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-8-oxo-2,3,4a,5,6,7,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-yl]oxy]-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid
Internal ID | 33185885-40b6-48d7-b0d5-3ac5778b876a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9S,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-8-oxo-2,3,4a,5,6,7,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-yl]oxy]-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(C(C(OC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CC(=O)C8(C7CC(CC8O)(C)C)C)C)C)C)C(=O)O)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@@H]3[C@H]([C@@H]([C@H](O[C@H]3O[C@H]4CC[C@]5([C@H](C4(C)C)CC[C@@]6([C@@H]5CC=C7[C@]6(CC(=O)[C@@]8([C@H]7CC(C[C@@H]8O)(C)C)C)C)C)C)C(=O)O)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C48H76O18/c1-20-29(52)31(54)35(58)40(61-20)65-37-32(55)30(53)23(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-13-14-45(6)24(44(28,4)5)12-15-46(7)25(45)11-10-21-22-16-43(2,3)17-26(50)48(22,9)27(51)18-47(21,46)8/h10,20,22-26,28-38,40-42,49-50,52-58H,11-19H2,1-9H3,(H,59,60)/t20-,22-,23+,24-,25+,26-,28-,29-,30+,31+,32-,33-,34-,35+,36-,37+,38+,40-,41-,42+,45-,46+,47+,48+/m0/s1 |
InChI Key | IGKHSWIPMMAPAG-GIOCRVJHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H76O18 |
Molecular Weight | 941.10 g/mol |
Exact Mass | 940.50316557 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.87% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.81% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.40% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.01% | 94.75% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.85% | 97.36% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.53% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.38% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.63% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.92% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.16% | 92.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.37% | 96.21% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.07% | 97.33% |
CHEMBL5028 | O14672 | ADAM10 | 81.40% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.32% | 90.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.68% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.56% | 89.00% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.55% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stylosanthes erecta |
PubChem | 16737976 |
LOTUS | LTS0240935 |
wikiData | Q105112684 |