Methyl 7'-chloro-4'-[2,5-dihydroxy-1-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-3',5-dihydroxy-8'-methoxy-6',7-dimethyl-4-oxospiro[1,3-benzodioxine-2,2'-tricyclo[4.3.1.03,7]deca-4,8-diene]-1'-carboxylate
| Internal ID | 8177b7fa-984a-4293-9221-749670721340 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
| IUPAC Name | methyl 7'-chloro-4'-[2,5-dihydroxy-1-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-3',5-dihydroxy-8'-methoxy-6',7-dimethyl-4-oxospiro[1,3-benzodioxine-2,2'-tricyclo[4.3.1.03,7]deca-4,8-diene]-1'-carboxylate |
| SMILES (Canonical) | CC1=CC(=C2C(=C1)OC3(C4(CC5(C=C(C3(C5(C(=C4)OC)Cl)O)C6=CC(C7C(C6O)(O7)CC=C(C)C)O)C)C(=O)OC)OC2=O)O |
| SMILES (Isomeric) | CC1=CC(=C2C(=C1)OC3(C4(CC5(C=C(C3(C5(C(=C4)OC)Cl)O)C6=CC(C7C(C6O)(O7)CC=C(C)C)O)C)C(=O)OC)OC2=O)O |
| InChI | InChI=1S/C33H35ClO11/c1-15(2)7-8-30-24(37)17(11-20(36)25(30)44-30)18-12-28(4)14-29(27(39)42-6)13-22(41-5)31(28,34)32(18,40)33(29)43-21-10-16(3)9-19(35)23(21)26(38)45-33/h7,9-13,20,24-25,35-37,40H,8,14H2,1-6H3 |
| InChI Key | YSIJCTYIYPFVHE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H35ClO11 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.1867896 g/mol |
| Topological Polar Surface Area (TPSA) | 165.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.48% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.06% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.00% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.34% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.82% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.84% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.43% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.77% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.90% | 94.80% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 89.36% | 96.76% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.22% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.39% | 90.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.99% | 91.07% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.89% | 94.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.19% | 96.77% |
| CHEMBL5028 | O14672 | ADAM10 | 82.84% | 97.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.19% | 92.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.19% | 96.90% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.64% | 97.14% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.55% | 91.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.13% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.91% | 89.50% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.75% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76187358 |
| LOTUS | LTS0099192 |
| wikiData | Q104202031 |