[3-Ethenyl-3,4a,7,7,10a-pentamethyl-10-(3-methylbut-2-enoyloxy)-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-8-yl] 2,3-dimethyloxirane-2-carboxylate
Internal ID | 892cd715-ab68-41cf-bec5-910d7dfdfd12 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [3-ethenyl-3,4a,7,7,10a-pentamethyl-10-(3-methylbut-2-enoyloxy)-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-8-yl] 2,3-dimethyloxirane-2-carboxylate |
SMILES (Canonical) | CC1C(O1)(C)C(=O)OC2CC(C3(C4CCC(OC4(C(=O)CC3C2(C)C)C)(C)C=C)C)OC(=O)C=C(C)C |
SMILES (Isomeric) | CC1C(O1)(C)C(=O)OC2CC(C3(C4CCC(OC4(C(=O)CC3C2(C)C)C)(C)C=C)C)OC(=O)C=C(C)C |
InChI | InChI=1S/C30H44O7/c1-11-27(7)13-12-19-28(8)20(15-21(31)30(19,10)37-27)26(5,6)22(35-25(33)29(9)18(4)36-29)16-23(28)34-24(32)14-17(2)3/h11,14,18-20,22-23H,1,12-13,15-16H2,2-10H3 |
InChI Key | BKRVAWZAKUQOFQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H44O7 |
Molecular Weight | 516.70 g/mol |
Exact Mass | 516.30870374 g/mol |
Topological Polar Surface Area (TPSA) | 91.40 Ų |
XlogP | 5.40 |
There are no found synonyms. |
![2D Structure of [3-Ethenyl-3,4a,7,7,10a-pentamethyl-10-(3-methylbut-2-enoyloxy)-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-8-yl] 2,3-dimethyloxirane-2-carboxylate 2D Structure of [3-Ethenyl-3,4a,7,7,10a-pentamethyl-10-(3-methylbut-2-enoyloxy)-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-8-yl] 2,3-dimethyloxirane-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/ed714300-8659-11ee-bfd9-5b8cd950d6f2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.97% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.96% | 91.11% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.52% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.37% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 92.25% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.88% | 99.23% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.74% | 95.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.03% | 97.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.27% | 85.30% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.70% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.26% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.72% | 86.33% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.65% | 97.53% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.35% | 94.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.37% | 85.14% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.68% | 93.04% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.44% | 85.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.33% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.61% | 93.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.39% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.36% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.15% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum ambiguum |
PubChem | 14262718 |
LOTUS | LTS0135248 |
wikiData | Q104937757 |