[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 653e7542-4d6f-4a48-9d45-3f345c9a73eb |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)COC(=O)C=CC5=CC(=C(C=C5)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C=C/C5=CC(=C(C=C5)O)O)O)O)O)O)O |
InChI | InChI=1S/C30H26O13/c31-16-5-3-15(4-6-16)22-12-21(35)26-20(34)10-17(11-23(26)42-22)41-30-29(39)28(38)27(37)24(43-30)13-40-25(36)8-2-14-1-7-18(32)19(33)9-14/h1-12,24,27-34,37-39H,13H2/b8-2+/t24-,27-,28+,29-,30-/m1/s1 |
InChI Key | MBMFVVJRZMJLSK-AESNYCIYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O13 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.13734088 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/ed11b280-880e-11ee-a6f6-41b91e37a478.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.66% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.00% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 97.52% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.27% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.70% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.04% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.93% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 90.79% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.55% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.01% | 95.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.94% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.74% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.47% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.98% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.75% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.57% | 86.92% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.03% | 95.64% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.97% | 95.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.83% | 97.28% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.29% | 85.31% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 82.18% | 98.35% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.70% | 80.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.57% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.17% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Perilla frutescens |
PubChem | 21579296 |
LOTUS | LTS0181993 |
wikiData | Q105160841 |