Echothiophate
| Internal ID | 9226c693-8d27-4278-bbe0-5c4c64c5b22c |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Quaternary ammonium salts > Tetraalkylammonium salts |
| IUPAC Name | 2-diethoxyphosphorylsulfanylethyl(trimethyl)azanium |
| SMILES (Canonical) | CCOP(=O)(OCC)SCC[N+](C)(C)C |
| SMILES (Isomeric) | CCOP(=O)(OCC)SCC[N+](C)(C)C |
| InChI | InChI=1S/C9H23NO3PS/c1-6-12-14(11,13-7-2)15-9-8-10(3,4)5/h6-9H2,1-5H3/q+1 |
| InChI Key | BJOLKYGKSZKIGU-UHFFFAOYSA-N |
| Popularity | 423 references in papers |
| Molecular Formula | C9H23NO3PS+ |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.11362677 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 1.00 |
| Ecothiopate |
| Ecothiopatum |
| 6736-03-4 |
| Echothiophate ion |
| Ecothiopate cation |
| Echothiophate cation |
| Phospholine iodide |
| 0F350BVT6S |
| CHEBI:4753 |
| 2-diethoxyphosphorylsulfanylethyl(trimethyl)azanium |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.35% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.91% | 83.82% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.20% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10548 |
| LOTUS | LTS0076618 |
| wikiData | Q4352952 |