[5-[Hydroxy-[3-[5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propyl]amino]-3-methyl-5-oxopent-3-enyl] 2-acetamido-5-[hydroxy-(5-hydroxy-3-methylpent-2-enoyl)amino]pentanoate
| Internal ID | 8bf1d158-5372-4dd2-b32c-5051a04f30b5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
| IUPAC Name | [5-[hydroxy-[3-[5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propyl]amino]-3-methyl-5-oxopent-3-enyl] 2-acetamido-5-[hydroxy-(5-hydroxy-3-methylpent-2-enoyl)amino]pentanoate |
| SMILES (Canonical) | CC(=CC(=O)NCCCC1C(=O)NC(C(=O)N1)CCCN(C(=O)C=C(C)CCOC(=O)C(CCCN(C(=O)C=C(C)CCO)O)NC(=O)C)O)CCO |
| SMILES (Isomeric) | CC(=CC(=O)NCCCC1C(=O)NC(C(=O)N1)CCCN(C(=O)C=C(C)CCOC(=O)C(CCCN(C(=O)C=C(C)CCO)O)NC(=O)C)O)CCO |
| InChI | InChI=1S/C35H56N6O12/c1-23(11-17-42)20-30(45)36-14-5-8-27-33(48)39-28(34(49)38-27)9-6-15-40(51)32(47)22-25(3)13-19-53-35(50)29(37-26(4)44)10-7-16-41(52)31(46)21-24(2)12-18-43/h20-22,27-29,42-43,51-52H,5-19H2,1-4H3,(H,36,45)(H,37,44)(H,38,49)(H,39,48) |
| InChI Key | MJHCDQBLJLBYQT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H56N6O12 |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 752.39562124 g/mol |
| Topological Polar Surface Area (TPSA) | 264.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.92% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.19% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.71% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.70% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.59% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.20% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.51% | 91.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 93.63% | 92.97% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.26% | 94.75% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.98% | 96.90% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.42% | 97.29% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 88.87% | 89.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.04% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.44% | 91.19% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.16% | 97.64% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.12% | 98.59% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.59% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.92% | 98.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.65% | 95.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.41% | 94.33% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.24% | 96.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.71% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.58% | 90.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.27% | 89.67% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.86% | 94.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.37% | 87.45% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.09% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162815922 |
| LOTUS | LTS0080327 |
| wikiData | Q104171753 |