(7-Hydroxy-3,10-dimethyl-6-methylidene-2-oxo-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) acetate
Internal ID | 45098411-04be-4148-bdb8-0e1b99169dd4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (7-hydroxy-3,10-dimethyl-6-methylidene-2-oxo-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) acetate |
SMILES (Canonical) | CC1C2CC(C(=C)C(CCC(=CC2OC1=O)C)O)OC(=O)C |
SMILES (Isomeric) | CC1C2CC(C(=C)C(CCC(=CC2OC1=O)C)O)OC(=O)C |
InChI | InChI=1S/C17H24O5/c1-9-5-6-14(19)11(3)15(21-12(4)18)8-13-10(2)17(20)22-16(13)7-9/h7,10,13-16,19H,3,5-6,8H2,1-2,4H3 |
InChI Key | RLKRDZUQPTUVBT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H24O5 |
Molecular Weight | 308.40 g/mol |
Exact Mass | 308.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of (7-Hydroxy-3,10-dimethyl-6-methylidene-2-oxo-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) acetate 2D Structure of (7-Hydroxy-3,10-dimethyl-6-methylidene-2-oxo-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-5-yl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ec7c5f20-8648-11ee-998b-d3ab9e113f0f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.42% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.40% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.49% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.73% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.68% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 86.18% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.10% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.91% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.41% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.39% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.39% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.51% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.48% | 97.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.71% | 94.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.14% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Seriphidium fragrans |
Seriphidium herba-alba |
Seriphidium vallesiacum |
PubChem | 85503169 |
LOTUS | LTS0193433 |
wikiData | Q104402294 |