(7R,8S)-3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol
Internal ID | 48c80d4c-814a-4911-b10c-ef2706faa60c |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (7R,8S)-3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol |
SMILES (Canonical) | C1C(C(OC2=C1C3=C(C(C(O3)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)C(=C2)O)C6=CC=C(C=C6)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=C1C3=C(C(C(O3)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)C(=C2)O)C6=CC=C(C=C6)O)O |
InChI | InChI=1S/C29H24O8/c30-17-5-1-14(2-6-17)27-23(35)12-21-24(36-27)13-22(34)26-25(16-9-19(32)11-20(33)10-16)28(37-29(21)26)15-3-7-18(31)8-4-15/h1-11,13,23,25,27-28,30-35H,12H2/t23-,25?,27+,28?/m0/s1 |
InChI Key | LYHUHVLRBIYLBQ-UIOXPAHSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H24O8 |
Molecular Weight | 500.50 g/mol |
Exact Mass | 500.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of (7R,8S)-3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol 2D Structure of (7R,8S)-3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol](https://plantaedb.com/storage/docs/compounds/2023/11/ec462df0-8147-11ee-b378-0daabea8ebde.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.74% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.46% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.03% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.49% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.43% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.81% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 83.85% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.81% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.79% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.48% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 81.42% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.32% | 90.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.55% | 91.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.43% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum gnemon |
PubChem | 10074697 |
LOTUS | LTS0270014 |
wikiData | Q105159335 |