[3-[3,5-dihydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 4'-benzoyloxy-3a,4-dihydroxy-5'-methyl-3-oxospiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-6-carboxylate
Internal ID | fb950fee-c88e-43a7-8178-381cf4415af9 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [3-[3,5-dihydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 4'-benzoyloxy-3a,4-dihydroxy-5'-methyl-3-oxospiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-6-carboxylate |
SMILES (Canonical) | CC1COC2(CC1OC(=O)C3=CC=CC=C3)C(=O)C4(C(CC(CC4O2)C(=O)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)O)O)O |
SMILES (Isomeric) | CC1COC2(CC1OC(=O)C3=CC=CC=C3)C(=O)C4(C(CC(CC4O2)C(=O)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)O)O)O |
InChI | InChI=1S/C38H52O23/c1-14-12-54-37(9-18(14)55-31(49)15-5-3-2-4-6-15)36(51)38(52)21(42)7-16(8-22(38)61-37)32(50)60-35-30(26(46)24(44)19(10-39)57-35)59-34-28(48)29(25(45)20(11-40)56-34)58-33-27(47)23(43)17(41)13-53-33/h2-6,14,16-30,33-35,39-48,52H,7-13H2,1H3 |
InChI Key | AGCHNHOAUSMARW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H52O23 |
Molecular Weight | 876.80 g/mol |
Exact Mass | 876.28993790 g/mol |
Topological Polar Surface Area (TPSA) | 357.00 Ų |
XlogP | -4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.96% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.89% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.77% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.69% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.65% | 91.49% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 95.95% | 94.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.18% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.13% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.92% | 95.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.66% | 94.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.42% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.34% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.96% | 94.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.81% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.68% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 85.50% | 97.50% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 85.28% | 94.97% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.25% | 83.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.89% | 91.19% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.85% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.73% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.73% | 99.23% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.52% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
PubChem | 162948426 |
LOTUS | LTS0155163 |
wikiData | Q104911696 |